Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D180280-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$3,132.90
|
|
| Synonyms | 1-(2,2-Diethoxyethyl)pyrazole-4-boronic acid | 1217501-20-6 | [1-(2,2-diethoxyethyl)pyrazol-4-yl]boronic acid | 1-(2,2-Diethoxyethyl)-1H-pyrazol-4-ylboronic acid | [1-(2,2-Diethoxyethyl)-1H-pyrazol-4-yl]boronic acid | SCHEMBL2555297 | DTXSID90675367 | MFCD12756418 | AKOS |
|---|---|
| Specifications & Purity | ≥95% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Azoles |
| Subclass | Pyrazoles |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Pyrazoles |
| Alternative Parents | Heteroaromatic compounds Boronic acids Organic metalloid salts Azacyclic compounds Acetals Organopnictogen compounds Organonitrogen compounds Organometalloid compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Heteroaromatic compound - Pyrazole - Boronic acid - Boronic acid derivative - Azacycle - Organic metalloid salt - Acetal - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Organic metalloid moeity - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as pyrazoles. These are compounds containing a pyrazole ring, which is a five-member aromatic ring with two nitrogen atoms (at positions 1 and 2) and three carbon atoms. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | [1-(2,2-diethoxyethyl)pyrazol-4-yl]boronic acid |
|---|---|
| INCHI | InChI=1S/C9H17BN2O4/c1-3-15-9(16-4-2)7-12-6-8(5-11-12)10(13)14/h5-6,9,13-14H,3-4,7H2,1-2H3 |
| InChIKey | QXGDFMFEWNRPLV-UHFFFAOYSA-N |
| Smiles | B(C1=CN(N=C1)CC(OCC)OCC)(O)O |
| Isomeric SMILES | B(C1=CN(N=C1)CC(OCC)OCC)(O)O |
| PubChem CID | 46739784 |
| Molecular Weight | 228.1 |
| Molecular Weight | 228.060 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 7 |
| Exact Mass | 228.128 Da |
| Monoisotopic Mass | 228.128 Da |
| Topological Polar Surface Area | 76.700 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 190.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |