Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C176350-500mg
|
500mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$3,269.90
|
|
| Synonyms | 1,1-Cyclobutanedimethanamine | 38932-71-7 | [1-(aminomethyl)cyclobutyl]methanamine | cyclobutane-1,1-diyldimethanamine | 1,1-Di(aminomethyl)cyclobutane | 1,1-Cyclobutanebis(methanamine) | 1-[1-(AMINOMETHYL)CYCLOBUTYL]METHANAMINE | SCHEMBL4117794 | OBEQILXWAPILBH-UHFFFAOY |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic nitrogen compounds |
| Class | Organonitrogen compounds |
| Subclass | Amines |
| Intermediate Tree Nodes | Primary amines |
| Direct Parent | Monoalkylamines |
| Alternative Parents | Organopnictogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aliphatic homomonocyclic compounds |
| Substituents | Organopnictogen compound - Hydrocarbon derivative - Primary aliphatic amine - Aliphatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as monoalkylamines. These are organic compounds containing an primary aliphatic amine group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | [1-(aminomethyl)cyclobutyl]methanamine |
|---|---|
| INCHI | InChI=1S/C6H14N2/c7-4-6(5-8)2-1-3-6/h1-5,7-8H2 |
| InChIKey | OBEQILXWAPILBH-UHFFFAOYSA-N |
| Smiles | C1CC(C1)(CN)CN |
| Isomeric SMILES | C1CC(C1)(CN)CN |
| Molecular Weight | 114.1888 |
| Reaxy-Rn | 13339653 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=13339653&ln= |
| Molecular Weight | 114.190 g/mol |
|---|---|
| XLogP3 | -0.500 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 2 |
| Exact Mass | 114.116 Da |
| Monoisotopic Mass | 114.116 Da |
| Topological Polar Surface Area | 52.000 Ų |
| Heavy Atom Count | 8 |
| Formal Charge | 0 |
| Complexity | 70.600 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |