Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
T162273-1ml
|
1ml |
3
|
$70.90
|
|
| Synonyms | HCC 260DB | DTXSID3024362 | SCHEMBL868495 | CAS-598-77-6 | FT-0632489 | LS-12954 | AKOS006230423 | NCGC00248597-01 | EINECS 209-951-8 | MFCD00018864 | D92379 | DTXCID604362 | T0686 | Q27290517 | Tox21_200408 | U085TG80D1 | 1,1,2-TRICHLOROPROPANE | NCGC002 |
|---|---|
| Specifications & Purity | ≥96%(GC) |
| Storage Temp | Store at 2-8°C |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organohalogen compounds |
| Class | Organochlorides |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Organochlorides |
| Alternative Parents | Hydrocarbon derivatives Alkyl chlorides |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Hydrocarbon derivative - Organochloride - Alkyl halide - Alkyl chloride - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as organochlorides. These are compounds containing a chemical bond between a carbon atom and a chlorine atom. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 504752185 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504752185 |
| IUPAC Name | 1,1,2-trichloropropane |
| INCHI | InChI=1S/C3H5Cl3/c1-2(4)3(5)6/h2-3H,1H3 |
| InChIKey | GRSQYISVQKPZCW-UHFFFAOYSA-N |
| Smiles | CC(C(Cl)Cl)Cl |
| Isomeric SMILES | CC(C(Cl)Cl)Cl |
| RTECS | TZ8925000 |
| PubChem CID | 11733 |
| Molecular Weight | 147.42 |
| Beilstein | 1(4)199 |
| Reaxy-Rn | 1731988 |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | May 08, 2024 | T162273 | |
| Certificate of Analysis | Oct 25, 2022 | T162273 | |
| Certificate of Analysis | Jun 14, 2022 | T162273 | |
| Certificate of Analysis | Mar 08, 2022 | T162273 |
| Refractive Index | 1.47 |
|---|---|
| Flash Point(°C) | 44 °C |
| Boil Point(°C) | 133°C |
| Molecular Weight | 147.430 g/mol |
| XLogP3 | 2.600 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 0 |
| Rotatable Bond Count | 1 |
| Exact Mass | 145.946 Da |
| Monoisotopic Mass | 145.946 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 6 |
| Formal Charge | 0 |
| Complexity | 35.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |