Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
Y753425-GMP-10mg
|
10mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,443.90
|
|
Y-27632 synthesized to cGMP guidelines
| Synonyms | trans-4-[(1R)-1-Aminoethyl]-N-4-pyridinylcyclohexanecarboxamide dihydrochloride |
|---|---|
| Specifications & Purity | GMP, ≥99% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
| Grade | GMP |
| Product Description |
Selective ROCK Inhibitor. Increases survival of ESCs and iPSCs undergoing cryopreservation |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic nitrogen compounds |
| Class | Organonitrogen compounds |
| Subclass | N-arylamides |
| Intermediate Tree Nodes | Not available |
| Direct Parent | N-arylamides |
| Alternative Parents | Pyridines and derivatives Heteroaromatic compounds Secondary carboxylic acid amides Amino acids and derivatives Azacyclic compounds Organic oxides Monoalkylamines Hydrochlorides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | N-arylamide - Pyridine - Heteroaromatic compound - Amino acid or derivatives - Carboxamide group - Secondary carboxylic acid amide - Organoheterocyclic compound - Carboxylic acid derivative - Azacycle - Organic oxide - Organic oxygen compound - Primary amine - Organooxygen compound - Primary aliphatic amine - Amine - Carbonyl group - Hydrochloride - Hydrocarbon derivative - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as n-arylamides. These are organic compounds that contain a carboxamide group that is N-linked to a aryl group. They have the generic structure RC(=O)N(R')H, R = organyl group and R'= aryl group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 4-[(1R)-1-aminoethyl]-N-pyridin-4-ylcyclohexane-1-carboxamide;dihydrochloride |
|---|---|
| INCHI | InChI=1S/C14H21N3O.2ClH/c1-10(15)11-2-4-12(5-3-11)14(18)17-13-6-8-16-9-7-13;;/h6-12H,2-5,15H2,1H3,(H,16,17,18);2*1H/t10-,11?,12?;;/m1../s1 |
| InChIKey | IDDDVXIUIXWAGJ-DDSAHXNVSA-N |
| Smiles | Cl.Cl.C[C@@H](N)[C@H]1CC[C@@H](CC1)C(=O)Nc2ccncc2 |
| Isomeric SMILES | C[C@H](C1CCC(CC1)C(=O)NC2=CC=NC=C2)N.Cl.Cl |
| WGK Germany | 3 |
| Molecular Weight | 320.26 |
| Specific Rotation[α] | +4.0° (C=1,MeOH) |
|---|---|
| Melt Point(°C) | 252 °C |
| Molecular Weight | 320.300 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 4 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 3 |
| Exact Mass | 319.122 Da |
| Monoisotopic Mass | 319.122 Da |
| Topological Polar Surface Area | 68.000 Ų |
| Heavy Atom Count | 20 |
| Formal Charge | 0 |
| Complexity | 268.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 1 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 3 |
| 1. Fan Zhao, Luchen Sun, Nanfei Yang, Wei Zheng, Pingping Shen, Yahong Huang, Yan Lu. (2020) Increased release of microvesicles containing mitochondria is associated with the myeloid differentiation of AML-M5 leukaemia cells. EXPERIMENTAL CELL RESEARCH, 395 (112213). |