Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
V162953-25ml
|
25ml |
2
|
$26.90
|
|
|
V162953-100ml
|
100ml |
2
|
$95.90
|
|
| Synonyms | AKOS015836289 | Vinylester kyseliny 2-ethylkapronove | NSC5312 | NSC-5312 | 2-ethyl hexanoic acid vinyl ester | Vinylester kyseliny 2-ethylkapronove [Czech] | Vinyl-2-ethylhexoate | NSC 5312 | VINYL 2-ETHYLHEXANOATE | Hexanoic acid, 2-ethyl-, ethenyl este |
|---|---|
| Specifications & Purity | ≥98%(GC) |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Lipids and lipid-like molecules |
| Class | Fatty Acyls |
| Subclass | Fatty acid esters |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Fatty acid esters |
| Alternative Parents | Enol esters Monocarboxylic acids and derivatives Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Fatty acid ester - Enol ester - Carboxylic acid ester - Monocarboxylic acid or derivatives - Carboxylic acid derivative - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Carbonyl group - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as fatty acid esters. These are carboxylic ester derivatives of a fatty acid. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 488183563 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488183563 |
| IUPAC Name | ethenyl 2-ethylhexanoate |
| INCHI | InChI=1S/C10H18O2/c1-4-7-8-9(5-2)10(11)12-6-3/h6,9H,3-5,7-8H2,1-2H3 |
| InChIKey | IGBZOHMCHDADGY-UHFFFAOYSA-N |
| Smiles | CCCCC(CC)C(=O)OC=C |
| Isomeric SMILES | CCCCC(CC)C(=O)OC=C |
| RTECS | MO7875000 |
| PubChem CID | 62343 |
| Molecular Weight | 170.25 |
| Beilstein | 2(4)1005 |
| Reaxy-Rn | 1767220 |
| Solubility | Insoluble in water; Soluble in Methanol |
|---|---|
| Refractive Index | 1.43 |
| Flash Point(°C) | 65°C(lit.) |
| Boil Point(°C) | 86°C/30mmHg(lit.) |
| Molecular Weight | 170.250 g/mol |
| XLogP3 | 3.500 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 7 |
| Exact Mass | 170.131 Da |
| Monoisotopic Mass | 170.131 Da |
| Topological Polar Surface Area | 26.300 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 141.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
Starting at $10.90