Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
I131995-5g
|
5g |
4
|
$339.90
|
|
|
I131995-25g
|
25g |
3
|
$1,526.90
|
|
| Synonyms | EINECS 203-570-0 | J-500788 | trans,trans-2,4-Hexadienyl acetate, 97% | FEMA no. 4132 | LMFA07010180 | AI3-24283 | A809197 | (2E,4E)-2,4-Hexadienyl acetate | AI3-08916 | DTXSID701283446 | (2E,4E)-2,4-hexadien-1-ol 1-acetate | AI3-32962 | ACETIC ACID, 2,4- |
|---|---|
| Specifications & Purity | ≥97% |
| Shipped In | Normal |
| Product Description |
Product Application: trans,trans-2,4-Hexadienyl acetate is used as an important raw material and intermediate used in organic Synthesis, pharmaceuticals, agrochemicals and dyestuff. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Carboxylic acids and derivatives |
| Subclass | Carboxylic acid derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Carboxylic acid esters |
| Alternative Parents | Monocarboxylic acids and derivatives Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Carboxylic acid ester - Monocarboxylic acid or derivatives - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Carbonyl group - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as carboxylic acid esters. These are carboxylic acid derivatives in which the carbon atom from the carbonyl group is attached to an alkyl or an aryl moiety through an oxygen atom (forming an ester group). |
| External Descriptors | Wax monoesters |
|
|
|
| Pubchem Sid | 488195435 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488195435 |
| IUPAC Name | [(2E,4E)-hexa-2,4-dienyl] acetate |
| INCHI | InChI=1S/C8H12O2/c1-3-4-5-6-7-10-8(2)9/h3-6H,7H2,1-2H3/b4-3+,6-5+ |
| InChIKey | PXVKYPFROMBALG-VNKDHWASSA-N |
| Smiles | CC=CC=CCOC(=O)C |
| Isomeric SMILES | C/C=C/C=C/COC(=O)C |
| WGK Germany | 3 |
| RTECS | AI0350000 |
| Molecular Weight | 140.18 |
| Reaxy-Rn | 1752601 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1752601&ln= |
| Solubility | Insoluble in water. |
|---|---|
| Refractive Index | n20/D 1.474 (lit.) |
| Flash Point(°F) | 71℃ |
| Flash Point(°C) | 159°F |
| Boil Point(°C) | 192-193 °C (lit.) |
| Molecular Weight | 140.180 g/mol |
| XLogP3 | 1.600 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 4 |
| Exact Mass | 140.084 Da |
| Monoisotopic Mass | 140.084 Da |
| Topological Polar Surface Area | 26.300 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 145.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 2 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 2 |
| Covalently-Bonded Unit Count | 1 |