Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
T113709-5g
|
5g |
1
|
$281.90
|
|
| Synonyms | J-010480 | T3506 | tetraethylazanium hydrogen sulfate | FT-0659633 | hydrogen sulfate;tetraethylazanium | CS-0128755 | AKOS015915196 | 3-PYRROLIDIN-1-YLACRYLICACIDMETHYLESTER | EINECS 240-899-9 | AS-69274 | DTXSID10168605 | Ethanaminium, N,N,N-triethyl-, |
|---|---|
| Specifications & Purity | Chromatographic grade |
| Storage Temp | Argon charged |
| Shipped In | Normal |
| Grade | Chromatographic grade |
| Product Description |
Tetraethylammonium hydrogen sulfate is an ion-pair chromatography (IPC) reagent suitable for anionic separation sorted by carbon chain length. Tetraethylammonium hydrogen sulfate may be used as an ion pair reagent for the analysis of sulfonated aliphatic and aromatic surfactants in sewage sludge by ion-pair/supercritical fluid extraction and derivatization gas chromatography/mass spectrometry. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Organic sulfuric acids and derivatives |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Organic sulfuric acids and derivatives |
| Alternative Parents | Tetraalkylammonium salts Organopnictogen compounds Organic salts Organic oxides Hydrocarbon derivatives Amines |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Tetraalkylammonium salt - Quaternary ammonium salt - Organic sulfuric acid or derivatives - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Organic oxide - Hydrocarbon derivative - Organic salt - Organonitrogen compound - Amine - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as organic sulfuric acids and derivatives. These are organic compounds containing the sulfuric acid or a derivative thereof. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | hydrogen sulfate;tetraethylazanium |
|---|---|
| INCHI | InChI=1S/C8H20N.H2O4S/c1-5-9(6-2,7-3)8-4;1-5(2,3)4/h5-8H2,1-4H3;(H2,1,2,3,4)/q+1;/p-1 |
| InChIKey | CREVBWLEPKAZBH-UHFFFAOYSA-M |
| Smiles | CC[N+](CC)(CC)CC.OS(=O)(=O)[O-] |
| Isomeric SMILES | CC[N+](CC)(CC)CC.OS(=O)(=O)[O-] |
| WGK Germany | 3 |
| PubChem CID | 167582 |
| Molecular Weight | 227.32 |
| Beilstein | 6590581 |
| Sensitivity | Hygroscopic |
|---|---|
| Melt Point(°C) | 243-245°C |
| Molecular Weight | 227.320 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 4 |
| Exact Mass | 227.119 Da |
| Monoisotopic Mass | 227.119 Da |
| Topological Polar Surface Area | 85.800 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 123.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |
| 1. Li Shuai, Yang Shenghai, Wang Changhong. (2022) Electrochemical Behavior of Tetraethylammonium-Hydrogen Sulfate-Based Electrodissolution-Coupled Hafnium Alkoxide Synthesis. JOM, 74 (9): (3548-3556). |
| 2. Shuai Li, Shenghai Yang, Kangkang Li, Yanqing Lai, Chaoyong Deng, Changhong Wang. (2022) Electrodissolution-Coupled Hafnium Alkoxide Synthesis with High Environmental and Economic Benefits. ChemSusChem, 15 (11): (e202200474). |
| 3. Jielin Huang, Jie Wang, Haonan Duan, Songsong Chen, Junping Zhang, Li Dong, Xiangping Zhang. (2024) Constructing mesoporous CeO2 single-crystal particles in ionic liquids for enhancing the conversion of CO2 and alcohols to carbonates. CHINESE JOURNAL OF CATALYSIS, 66 (152). |
| 4. Shuai LI, Sheng-hai YANG, Yong-ming CHEN, Chao-bo TANG, Yan-qing LAI, Chao-yong DENG, Chang-hong WANG. (2024) Electrochemical mechanism and kinetics of electrodissolution-coupled hafnium alkoxide synthesis in tetraethylammonium-chloride-based anhydrous system. TRANSACTIONS OF NONFERROUS METALS SOCIETY OF CHINA, 34 (1681). |