F2307516Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
Basic Description
| Synonyms | Tetraethyl 1,1,2,2-ethanetetracarboxylate | TETRAethyl-1,1,2,2-ETHANETETRACARBOXYLATE | Tetraethyl1,1,2,2-ethanetetracarboxylate | SCHEMBL2460611 | UNII-5G8A5ZPV2T | AI3-11223 | Tetraethyl ethane-1,1,2,2-tetracarboxylate | EINECS 211-180-7 | Tetrakis(etho |
|---|---|
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomic Classification
Taxonomy Tree
-
Kingdom
Organic compounds
- Superclass Organic acids and derivatives
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Carboxylic acids and derivatives |
| Subclass | Tetracarboxylic acids and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Tetracarboxylic acids and derivatives |
| Alternative Parents | Fatty acid esters 1,3-dicarbonyl compounds Carboxylic acid esters Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Tetracarboxylic acid or derivatives - Fatty acid ester - Fatty acyl - 1,3-dicarbonyl compound - Carboxylic acid ester - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Carbonyl group - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as tetracarboxylic acids and derivatives. These are carboxylic acids containing exactly four carboxyl groups. |
| External Descriptors | Not available |
|
|
|
Names and Identifiers
| Pubchem Sid | 488185679 |
|---|---|
| IUPAC Name | tetraethyl ethane-1,1,2,2-tetracarboxylate |
| INCHI | InChI=1S/C14H22O8/c1-5-19-11(15)9(12(16)20-6-2)10(13(17)21-7-3)14(18)22-8-4/h9-10H,5-8H2,1-4H3 |
| InChIKey | UQSBVZIXVVORQC-UHFFFAOYSA-N |
| Smiles | CCOC(=O)C(C(C(=O)OCC)C(=O)OCC)C(=O)OCC |
| Isomeric SMILES | CCOC(=O)C(C(C(=O)OCC)C(=O)OCC)C(=O)OCC |
| WGK Germany | 3 |
| PubChem CID | 79090 |
| Molecular Weight | 318.32 |
Certificates（CoA,COO,BSE/TSE and Analysis Chart)
C of A & Other Certificates(BSE/TSE, COO):
Analytical Chart:
Chemical and Physical Properties
| Molecular Weight | 318.320 g/mol |
|---|---|
| XLogP3 | 1.600 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 8 |
| Rotatable Bond Count | 13 |
| Exact Mass | 318.131 Da |
| Monoisotopic Mass | 318.131 Da |
| Topological Polar Surface Area | 105.000 Ų |
| Heavy Atom Count | 22 |
| Formal Charge | 0 |
| Complexity | 330.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
Solution Calculators
Reviews
Customer Reviews
Remind me later