Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
T633724-100mg
|
100mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$383.90
|
|
|
T633724-250mg
|
250mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$639.90
|
|
|
T633724-500mg
|
500mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$895.90
|
|
|
T633724-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,537.90
|
|
| Synonyms | (1R,6S)-TERT-BUTYL3,8-DIAZABICYCLO[4.2.0]OCTANE-8-CARBOXYLATE | EN300-716243 | CS-0088195 | MFCD14581309 | tert-butyl (1r,6s)-3,8-diazabicyclo[4.2.0]octane-8-carboxylate | (1R,6S)-3,8-Diaza-bicyclo[4.2.0]octane-8-carboxylic acid tert-butyl ester | (1R,6S) |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Azetidines |
| Subclass | Azetidinecarboxylic acids or derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Azetidinecarboxylic acids |
| Alternative Parents | Piperidines Carbamate esters Dialkylamines Azacyclic compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic heteropolycyclic compounds |
| Substituents | Azetidinecarboxylic acid - Piperidine - Carbamic acid ester - Azacycle - Secondary amine - Secondary aliphatic amine - Organic nitrogen compound - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Carbonyl group - Amine - Aliphatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as azetidinecarboxylic acids. These are organic compounds containing a carboxylic acid group attached to an azetidine ring. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | tert-butyl (1R,6S)-3,8-diazabicyclo[4.2.0]octane-8-carboxylate |
|---|---|
| INCHI | InChI=1S/C11H20N2O2/c1-11(2,3)15-10(14)13-7-8-4-5-12-6-9(8)13/h8-9,12H,4-7H2,1-3H3/t8-,9-/m0/s1 |
| InChIKey | ITVHTQLHEQGQNG-IUCAKERBSA-N |
| Smiles | CC(C)(C)OC(=O)N1CC2C1CNCC2 |
| Isomeric SMILES | CC(C)(C)OC(=O)N1C[C@H]2[C@@H]1CNCC2 |
| Alternate CAS | 370881-00-8 |
| PubChem CID | 16099058 |
| Molecular Weight | 212.290 g/mol |
|---|---|
| XLogP3 | 0.900 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 2 |
| Exact Mass | 212.152 Da |
| Monoisotopic Mass | 212.152 Da |
| Topological Polar Surface Area | 41.600 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 260.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 2 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |