Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
T113882-250ml
|
250ml |
1
|
$44.90
|
|
| Synonyms | 2-(2,6,8-Trimethyl-4-nonyloxy)ethanol | Ethyleneglycolmono-2,6,8-trimethyl-4-nonyl ether | 2-(2,6,8-trimethylnonan-4-yloxy)ethanol | DTXSID00873978 | BRN 1851894 | ETHANOL, 2-((1-ISOBUTYL-3,5-DIMETHYLHEXYL)OXY)- | Ethanol, 2-((3,5-dimethyl-1-(2-methylprop |
|---|---|
| Specifications & Purity | ≥90% active ingredients basis |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Class | Organooxygen compounds |
| Subclass | Ethers |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Dialkyl ethers |
| Alternative Parents | Primary alcohols Hydrocarbon derivatives |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Dialkyl ether - Hydrocarbon derivative - Primary alcohol - Alcohol - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as dialkyl ethers. These are organic compounds containing the dialkyl ether functional group, with the formula ROR', where R and R' are alkyl groups. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 504753290 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504753290 |
| IUPAC Name | 2-(2,6,8-trimethylnonan-4-yloxy)ethanol |
| INCHI | InChI=1S/C14H30O2/c1-11(2)8-13(5)10-14(9-12(3)4)16-7-6-15/h11-15H,6-10H2,1-5H3 |
| InChIKey | VKKFWRYCMZBXIG-UHFFFAOYSA-N |
| Smiles | CC(C)CC(C)CC(CC(C)C)OCCO |
| Isomeric SMILES | CC(C)CC(C)CC(CC(C)C)OCCO |
| WGK Germany | 2 |
| RTECS | MD0907900 |
| PubChem CID | 24982 |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Nov 02, 2023 | T113882 | |
| Certificate of Analysis | Jun 05, 2023 | T113882 | |
| Certificate of Analysis | Jul 14, 2022 | T113882 | |
| Certificate of Analysis | Jul 14, 2022 | T113882 |
| Flash Point(°C) | 130°C |
|---|---|
| Molecular Weight | 230.390 g/mol |
| XLogP3 | 4.200 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 9 |
| Exact Mass | 230.225 Da |
| Monoisotopic Mass | 230.225 Da |
| Topological Polar Surface Area | 29.500 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 155.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 2 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |