Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
S176330-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$123.90
|
|
| Synonyms | Dimethyl Spiro[3.3]heptane-2,6-dicarboxylate | 27259-79-6 | 37942-79-3 | 2,6-DIMETHYL SPIRO[3.3]HEPTANE-2,6-DICARBOXYLATE | Spiro[3.3]heptane-2,6-dicarboxylic acid, 2,6-dimethyl ester | Spiro[3.3]heptane-2,6-dicarboxylic acid, dimethyl ester | MFCD11099889 | DTXSID1012 |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Carboxylic acids and derivatives |
| Subclass | Dicarboxylic acids and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Dicarboxylic acids and derivatives |
| Alternative Parents | Methyl esters Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic homopolycyclic compounds |
| Substituents | Dicarboxylic acid or derivatives - Methyl ester - Carboxylic acid ester - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Carbonyl group - Aliphatic homopolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as dicarboxylic acids and derivatives. These are organic compounds containing exactly two carboxylic acid groups. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | dimethyl spiro[3.3]heptane-2,6-dicarboxylate |
|---|---|
| INCHI | InChI=1S/C11H16O4/c1-14-9(12)7-3-11(4-7)5-8(6-11)10(13)15-2/h7-8H,3-6H2,1-2H3 |
| InChIKey | WDSRXUBJASECTM-UHFFFAOYSA-N |
| Smiles | COC(=O)C1CC2(C1)CC(C2)C(=O)OC |
| Isomeric SMILES | COC(=O)C1CC2(C1)CC(C2)C(=O)OC |
| PubChem CID | 10262596 |
| Molecular Weight | 212.245 |
| Molecular Weight | 212.240 g/mol |
|---|---|
| XLogP3 | 1.000 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 4 |
| Exact Mass | 212.105 Da |
| Monoisotopic Mass | 212.105 Da |
| Topological Polar Surface Area | 52.600 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 251.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |