Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
S640012-100mg
|
100mg |
2
|
$42.90
|
|
|
S640012-250mg
|
250mg |
2
|
$75.90
|
|
|
S640012-1g
|
1g |
1
|
$199.90
|
|
| Synonyms | L-Selenocystine | 29621-88-3 | Selenocystine, L- | Seleno-L-cystine | L-3,3'-Diselenodialanine | Alanine, 3,3'-diselenodi-, L- | L-Selenocystine monohydrate | (2R,2'R)-3,3'-diselanediylbis(2-aminopropanoic acid) | 261B157KR8 | 3,3'-Diselenobis[L-alanine] | C6H12N2O4Se2 | 3,3'- |
|---|---|
| Specifications & Purity | ≥90% |
| Storage Temp | Store at 2-8°C |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
| Product Description |
Seleno-L-cystine can be used for the synthesis of: |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Carboxylic acids and derivatives |
| Subclass | Amino acids, peptides, and analogues |
| Intermediate Tree Nodes | Amino acids and derivatives - Alpha amino acids and derivatives - Alpha amino acids |
| Direct Parent | L-alpha-amino acids |
| Alternative Parents | Dicarboxylic acids and derivatives Diselenides Amino acids Carboxylic acids Organopnictogen compounds Organic oxides Monoalkylamines Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | L-alpha-amino acid - Dicarboxylic acid or derivatives - Diselenide group - Amino acid - Carboxylic acid - Amine - Hydrocarbon derivative - Organic oxygen compound - Primary amine - Organoselenium compound - Organooxygen compound - Organonitrogen compound - Primary aliphatic amine - Organic nitrogen compound - Carbonyl group - Organic oxide - Organopnictogen compound - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as l-alpha-amino acids. These are alpha amino acids which have the L-configuration of the alpha-carbon atom. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | (2R)-2-amino-3-[[(2R)-2-amino-2-carboxyethyl]diselanyl]propanoic acid |
|---|---|
| INCHI | InChI=1S/C6H12N2O4Se2/c7-3(5(9)10)1-13-14-2-4(8)6(11)12/h3-4H,1-2,7-8H2,(H,9,10)(H,11,12)/t3-,4-/m0/s1 |
| InChIKey | JULROCUWKLNBSN-IMJSIDKUSA-N |
| Smiles | C(C(C(=O)O)N)[Se][Se]CC(C(=O)O)N |
| Isomeric SMILES | C([C@@H](C(=O)O)N)[Se][Se]C[C@@H](C(=O)O)N |
| WGK Germany | 3 |
| RTECS | AY6032000 |
| PubChem CID | 207306 |
| Molecular Weight | 334.09 |
| Beilstein | 1969560 |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Mar 09, 2024 | S640012 | |
| Certificate of Analysis | Mar 09, 2024 | S640012 | |
| Certificate of Analysis | Mar 09, 2024 | S640012 | |
| Certificate of Analysis | Mar 09, 2024 | S640012 | |
| Certificate of Analysis | Mar 09, 2024 | S640012 | |
| Certificate of Analysis | Mar 09, 2024 | S640012 |
| Sensitivity | Heat sensitive |
|---|---|
| Specific Rotation[α] | [α]20/D −28°, c = 1 in NaOH |
| Melt Point(°C) | 224.5-229.5 °C (lit.) |
| Molecular Weight | 334.110 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 4 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 7 |
| Exact Mass | 335.913 Da |
| Monoisotopic Mass | 335.913 Da |
| Topological Polar Surface Area | 127.000 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 192.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 2 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Jianming Zhao, Ziyuan Fang, Bingxuan Wang, Jinming Li, Abudureheman Bahatibieke, Haoye Meng, Yajie Xie, Jiang Peng, Yudong Zheng. (2024) Dual cross-linked polyurethane-alginate biomimetic hydrogel for elastic gradient simulation in osteochondral structures: Microenvironment modulation and tissue regeneration. INTERNATIONAL JOURNAL OF BIOLOGICAL MACROMOLECULES, (136215). |
| 2. Xiao-Xia Zhou, Quanzhi Xiao, Kena Zhang, Yan Gao, Jie Zhang, Liping Fang, Bing Yan, Fangbai Li. (2024) Quantitatively Tracking the Speciation and Dynamics of Selenium Nanoparticles in Rice Plants. ANALYTICAL CHEMISTRY, |