Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
S478939-500mg
|
500mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$153.90
|
|
| Synonyms | b-butyl methacrylate | NSC 32630 | Q27256668 | B5371 | sec-Butyl methacrylate, AldrichCPR | 2-Propenoic acid, 2-methyl-, 1-methylpropyl ester | b-n-butyl methacrylate | SEC-BUTYL METHACRYLATE [INCI] | sec-Butyl methacrylate | MFCD00048637 | FT-0695269 | 3 |
|---|---|
| Specifications & Purity | Reagent grade |
| Grade | Reagent Grade |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Carboxylic acids and derivatives |
| Subclass | Carboxylic acid derivatives |
| Intermediate Tree Nodes | Carboxylic acid esters - Alpha,beta-unsaturated carboxylic esters |
| Direct Parent | Enoate esters |
| Alternative Parents | Monocarboxylic acids and derivatives Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Enoate ester - Monocarboxylic acid or derivatives - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Carbonyl group - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as enoate esters. These are an alpha,beta-unsaturated carboxylic ester of general formula R1C(R2)=C(R3)C(=O)OR4 (R4= organyl compound) in which the ester C=O function is conjugated to a C=C double bond at the alpha,beta position. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | butan-2-yl 2-methylprop-2-enoate |
|---|---|
| INCHI | InChI=1S/C8H14O2/c1-5-7(4)10-8(9)6(2)3/h7H,2,5H2,1,3-4H3 |
| InChIKey | VXTQKJXIZHSXBY-UHFFFAOYSA-N |
| Smiles | CCC(C)OC(=O)C(=C)C |
| Isomeric SMILES | CCC(C)OC(=O)C(=C)C |
| WGK Germany | 3 |
| PubChem CID | 97732 |
| Molecular Weight | 142.2 |
| Flash Point(°F) | 111.2 °F |
|---|---|
| Flash Point(°C) | 44 °C |
| Molecular Weight | 142.200 g/mol |
| XLogP3 | 2.800 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 4 |
| Exact Mass | 142.099 Da |
| Monoisotopic Mass | 142.099 Da |
| Topological Polar Surface Area | 26.300 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 138.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |