Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
R479433-10mg
|
10mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$153.90
|
|
| Synonyms | 12-hydroxyl-9-octadecenoic acid | FT-0774278 | RICINELAIDIC ACID FREE ACID | DTXSID20859274 | 9-Octadecenoic acid, 12-hydroxy-, (9Z,12R)- | FT-0607233 | MEGxp0_002003 | 12-hydroxyoctadec-9-enoic acid | ACon1_000440 | SB44559 |
|---|---|
| Specifications & Purity | Reagent grade |
| Grade | Reagent Grade |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Lipids and lipid-like molecules |
| Class | Fatty Acyls |
| Subclass | Fatty acids and conjugates |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Long-chain fatty acids |
| Alternative Parents | Hydroxy fatty acids Unsaturated fatty acids Secondary alcohols Monocarboxylic acids and derivatives Carboxylic acids Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Long-chain fatty acid - Hydroxy fatty acid - Unsaturated fatty acid - Secondary alcohol - Monocarboxylic acid or derivatives - Carboxylic acid - Carboxylic acid derivative - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Carbonyl group - Alcohol - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as long-chain fatty acids. These are fatty acids with an aliphatic tail that contains between 13 and 21 carbon atoms. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 12-hydroxyoctadec-9-enoic acid |
|---|---|
| INCHI | InChI=1S/C18H34O3/c1-2-3-4-11-14-17(19)15-12-9-7-5-6-8-10-13-16-18(20)21/h9,12,17,19H,2-8,10-11,13-16H2,1H3,(H,20,21) |
| InChIKey | WBHHMMIMDMUBKC-UHFFFAOYSA-N |
| Smiles | CCCCCCC(CC=CCCCCCCCC(=O)O)O |
| Isomeric SMILES | CCCCCCC(CC=CCCCCCCCC(=O)O)O |
| PubChem CID | 8839 |
| Molecular Weight | 298.46 |
| Flash Point(°F) | Not applicable |
|---|---|
| Flash Point(°C) | Not applicable |
| Molecular Weight | 298.500 g/mol |
| XLogP3 | 5.700 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 15 |
| Exact Mass | 298.251 Da |
| Monoisotopic Mass | 298.251 Da |
| Topological Polar Surface Area | 57.500 Ų |
| Heavy Atom Count | 21 |
| Formal Charge | 0 |
| Complexity | 261.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 1 |
| The total count of all stereochemical bonds | 1 |
| Covalently-Bonded Unit Count | 1 |