Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
R467243-250mg
|
250mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$611.90
|
|
| Synonyms | PS-12343 | D-beta-Homopropargylglycine hydrochloride | DTXSID00657851 | (3R)-3-Aminohex-5-ynoic acid--hydrogen chloride (1/1) | (R)-3-Amino-5-hexynoic acid-HCl | (3R)-3-AMINOHEX-5-YNOIC ACID HYDROCHLORIDE | (R)-3-Aminohex-5-ynoicacidhydrochloride | (R)-3- |
|---|---|
| Specifications & Purity | ≥95% |
| Storage Temp | Store at 2-8°C |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Carboxylic acids and derivatives |
| Subclass | Amino acids, peptides, and analogues |
| Intermediate Tree Nodes | Amino acids and derivatives |
| Direct Parent | Beta amino acids and derivatives |
| Alternative Parents | Medium-chain fatty acids Amino fatty acids Unsaturated fatty acids Amino acids Monocarboxylic acids and derivatives Carboxylic acids Acetylides Organic oxides Monoalkylamines Hydrochlorides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Beta amino acid or derivatives - Medium-chain fatty acid - Amino fatty acid - Unsaturated fatty acid - Fatty acid - Fatty acyl - Amino acid - Carboxylic acid - Monocarboxylic acid or derivatives - Acetylide - Organic nitrogen compound - Primary amine - Organooxygen compound - Organonitrogen compound - Amine - Primary aliphatic amine - Carbonyl group - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Hydrochloride - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as beta amino acids and derivatives. These are amino acids having a (-NH2) group attached to the beta carbon atom. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | (3R)-3-aminohex-5-ynoic acid;hydrochloride |
|---|---|
| INCHI | InChI=1S/C6H9NO2.ClH/c1-2-3-5(7)4-6(8)9;/h1,5H,3-4,7H2,(H,8,9);1H/t5-;/m1./s1 |
| InChIKey | FVKOZZHCHSRKJA-NUBCRITNSA-N |
| Smiles | C#CCC(CC(=O)O)N.Cl |
| Isomeric SMILES | C#CC[C@H](CC(=O)O)N.Cl |
| WGK Germany | 3 |
| PubChem CID | 44203002 |
| Molecular Weight | 163.6 |
| Molecular Weight | 163.600 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 3 |
| Exact Mass | 163.04 Da |
| Monoisotopic Mass | 163.04 Da |
| Topological Polar Surface Area | 63.300 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 144.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 1 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |