Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
R590501-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$362.90
|
|
| Synonyms | (R)-1-(3-methoxyphenyl) ethanamine | EC 618-126-5 | Benzenemethanamine,3-methoxy-a-methyl-,(aR)- | (R)-(+)-1-(3-Methoxyphenyl)ethylamine | (R)-(+)-1-(3-methoxyphenyl)-ethylamine | AKOS012536234 | MFCD00671655 | (R)-1-(3-Methoxyphenyl)ethanamine | (r)-1-(3 |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Store at 2-8°C,Protected from light,Argon charged |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Phenol ethers |
| Subclass | Anisoles |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Anisoles |
| Alternative Parents | Phenoxy compounds Methoxybenzenes Aralkylamines Alkyl aryl ethers Monoalkylamines Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Phenoxy compound - Anisole - Methoxybenzene - Alkyl aryl ether - Aralkylamine - Monocyclic benzene moiety - Ether - Organic nitrogen compound - Organooxygen compound - Organonitrogen compound - Primary aliphatic amine - Primary amine - Hydrocarbon derivative - Organic oxygen compound - Amine - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as anisoles. These are organic compounds containing a methoxybenzene or a derivative thereof. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | (1R)-1-(3-methoxyphenyl)ethanamine |
|---|---|
| INCHI | InChI=1S/C9H13NO/c1-7(10)8-4-3-5-9(6-8)11-2/h3-7H,10H2,1-2H3/t7-/m1/s1 |
| InChIKey | CJWGCBRQAHCVHW-SSDOTTSWSA-N |
| Smiles | CC(C1=CC(=CC=C1)OC)N |
| Isomeric SMILES | C[C@H](C1=CC(=CC=C1)OC)N |
| Molecular Weight | 151.209 |
| Reaxy-Rn | 2413028 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2413028&ln= |
| Boil Point(°C) | 66 °C |
|---|---|
| Melt Point(°C) | 5°C |
| Molecular Weight | 151.210 g/mol |
| XLogP3 | 1.600 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 2 |
| Exact Mass | 151.1 Da |
| Monoisotopic Mass | 151.1 Da |
| Topological Polar Surface Area | 35.300 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 116.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 1 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |