Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B301147-1g
|
1g |
2
|
$535.90
|
|
| Synonyms | (R)-(-)-1-(1-Naphthyl)ethyl isothiocyanate | 138617-82-0 | 1-[(1R)-1-ISOTHIOCYANATOETHYL]NAPHTHALENE | Naphthalene, 1-[(1R)-1-isothiocyanatoethyl]- | SCHEMBL3886974 | DTXSID10426818 | MFCD04039332 | (R)-1-(1-Naphthyl)ethyl isothiocyanate | BP-12879 |
|---|---|
| Specifications & Purity | ≥95% |
| Storage Temp | Store at 2-8°C |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Naphthalenes |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Naphthalenes |
| Alternative Parents | Isothiocyanates Propargyl-type 1,3-dipolar organic compounds Organonitrogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic homopolycyclic compounds |
| Substituents | Naphthalene - Isothiocyanate - Organic 1,3-dipolar compound - Propargyl-type 1,3-dipolar organic compound - Organic nitrogen compound - Hydrocarbon derivative - Organosulfur compound - Organonitrogen compound - Aromatic homopolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as naphthalenes. These are compounds containing a naphthalene moiety, which consists of two fused benzene rings. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 504764554 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504764554 |
| IUPAC Name | 1-[(1R)-1-isothiocyanatoethyl]naphthalene |
| INCHI | InChI=1S/C13H11NS/c1-10(14-9-15)12-8-4-6-11-5-2-3-7-13(11)12/h2-8,10H,1H3/t10-/m1/s1 |
| InChIKey | PGJWLIIUEIYCSF-SNVBAGLBSA-N |
| Smiles | CC(C1=CC=CC2=CC=CC=C21)N=C=S |
| Isomeric SMILES | C[C@H](C1=CC=CC2=CC=CC=C21)N=C=S |
| Molecular Weight | 213.3 |
| Reaxy-Rn | 8481207 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=8481207&ln= |
| Molecular Weight | 213.300 g/mol |
|---|---|
| XLogP3 | 5.100 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 2 |
| Exact Mass | 213.061 Da |
| Monoisotopic Mass | 213.061 Da |
| Topological Polar Surface Area | 44.500 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 257.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 1 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
Starting at $49.90
Starting at $31.90
Starting at $260.90
Starting at $189.90
Starting at $186.90
Starting at $313.90