Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
P298952-5g
|
5g |
2
|
$216.90
|
|
|
P298952-25g
|
25g |
3
|
$455.90
|
|
| Synonyms | Phytic acid (potassium) | SCHEMBL1658128 | PD054428 | J-521537 | dipotassium;[(2R,3R,5S,6R)-2,3,4,5,6-pentaphosphonooxycyclohexyl] phosphate | AKOS016010223 | Inositol hexakisphosphate dipotassium salt | Fytic Acid dipotassium salt | Potassium (1R,2S,3R,4 |
|---|---|
| Specifications & Purity | ≥80% |
| Storage Temp | Store at 2-8°C |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Class | Organooxygen compounds |
| Subclass | Alcohols and polyols |
| Intermediate Tree Nodes | Cyclic alcohols and derivatives - Cyclitols and derivatives |
| Direct Parent | Inositol phosphates |
| Alternative Parents | Monoalkyl phosphates Organic potassium salts Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aliphatic homomonocyclic compounds |
| Substituents | Inositol phosphate - Monoalkyl phosphate - Alkyl phosphate - Phosphoric acid ester - Organic phosphoric acid derivative - Organic alkali metal salt - Organic oxide - Hydrocarbon derivative - Organic potassium salt - Organic salt - Aliphatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as inositol phosphates. These are compounds containing a phosphate group attached to an inositol (or cyclohexanehexol) moiety. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 504769314 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504769314 |
| IUPAC Name | dipotassium;[(2R,3S,5R,6R)-2,3,4,5,6-pentaphosphonooxycyclohexyl] phosphate |
| INCHI | InChI=1S/C6H18O24P6.2K/c7-31(8,9)25-1-2(26-32(10,11)12)4(28-34(16,17)18)6(30-36(22,23)24)5(29-35(19,20)21)3(1)27-33(13,14)15;;/h1-6H,(H2,7,8,9)(H2,10,11,12)(H2,13,14,15)(H2,16,17,18)(H2,19,20,21)(H2,22,23,24);;/q;2*+1/p-2/t1-,2-,3?,4?,5-,6+;;/m0../s1 |
| InChIKey | LFTTXUFEVNNTHA-OKBOCSEJSA-L |
| Smiles | C1(C(C(C(C(C1OP(=O)(O)O)OP(=O)(O)O)OP(=O)([O-])[O-])OP(=O)(O)O)OP(=O)(O)O)OP(=O)(O)O.[K+].[K+] |
| Isomeric SMILES | [C@H]1([C@@H](C([C@H]([C@@H](C1OP(=O)(O)O)OP(=O)(O)O)OP(=O)(O)O)OP(=O)([O-])[O-])OP(=O)(O)O)OP(=O)(O)O.[K+].[K+] |
| PubChem CID | 22838972 |
| Molecular Weight | 736.22 |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | May 09, 2023 | P298952 |
| Molecular Weight | 736.220 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 10 |
| Hydrogen Bond Acceptor Count | 24 |
| Rotatable Bond Count | 11 |
| Exact Mass | 735.773 Da |
| Monoisotopic Mass | 735.773 Da |
| Topological Polar Surface Area | 406.000 Ų |
| Heavy Atom Count | 38 |
| Formal Charge | 0 |
| Complexity | 975.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 4 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 3 |
| 1. Congcong Liu, Min Guo, Haijun Su, Peng Zhai, Keyu Xie, Zhike Liu, Jun Zhang, Lin Liu, Hengzhi Fu. (2022) Highly improved efficiency and stability of planar perovskite solar cells via bifunctional phytic acid dipotassium anchored SnO2 electron transport layer. APPLIED SURFACE SCIENCE, 588 (152943). |