Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
P472012-1g
|
1g |
3
|
$567.90
|
|
|
P472012-250mg
|
250mg |
4
|
$200.90
|
|
| Synonyms | Q63408938 | 2,3,4,5,6-pentadeuteriophenol | Phen-d5-ol | PHENOL (2,3,4,5,6-D5) | Phenol-d5 | MFCD00084164 | Phenol-2,3,4,5,6 D5; Phenol (ring-D5); Phen-2,3,4,5,6-d5-ol; Phen-d5-ol (7CI,8CI,9CI); 2,3,4,5,6-Pentadeuteriophenol | Phenol-2,3,4,5,6-d5, 98 atom |
|---|---|
| Specifications & Purity | ≥98 atom% D,≥98% |
| Storage Temp | Store at 2-8°C,Protected from light |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
| Product Description |
Description Phenol-2,3,4,5,6-d5is an isotope-labeled analog of phenol, wherein 2,3,4, 5, and 6thprotons of phenol are replaced by deuterium.Phenol-2,3,4,5,6-d5can be used as an internal analytical standard for accurate data interpretation using various analytical techniques. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Phenols |
| Subclass | 1-hydroxy-4-unsubstituted benzenoids |
| Intermediate Tree Nodes | Not available |
| Direct Parent | 1-hydroxy-4-unsubstituted benzenoids |
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids Benzene and substituted derivatives Organooxygen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | 1-hydroxy-4-unsubstituted benzenoid - 1-hydroxy-2-unsubstituted benzenoid - Monocyclic benzene moiety - Organic oxygen compound - Hydrocarbon derivative - Organooxygen compound - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as 1-hydroxy-4-unsubstituted benzenoids. These are phenols that are unsubstituted at the 4-position. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 488197941 |
|---|---|
| IUPAC Name | 2,3,4,5,6-pentadeuteriophenol |
| INCHI | InChI=1S/C6H6O/c7-6-4-2-1-3-5-6/h1-5,7H/i1D,2D,3D,4D,5D |
| InChIKey | ISWSIDIOOBJBQZ-RALIUCGRSA-N |
| Smiles | C1=CC=C(C=C1)O |
| Isomeric SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])O)[2H])[2H] |
| WGK Germany | 3 |
| Molecular Weight | 99.14 |
| Reaxy-Rn | 969616 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=969616&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Feb 24, 2023 | P472012 | |
| Certificate of Analysis | Feb 24, 2023 | P472012 | |
| Certificate of Analysis | Feb 24, 2023 | P472012 | |
| Certificate of Analysis | Feb 24, 2023 | P472012 |
| Sensitivity | Light sensitive |
|---|---|
| Flash Point(°F) | 174.2 °F |
| Flash Point(°C) | 79 °C |
| Boil Point(°C) | 182 °C (lit.) |
| Melt Point(°C) | 40-42 °C (lit.) |
| Molecular Weight | 99.140 g/mol |
| XLogP3 | 1.500 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 0 |
| Exact Mass | 99.0732 Da |
| Monoisotopic Mass | 99.0732 Da |
| Topological Polar Surface Area | 20.200 Ų |
| Heavy Atom Count | 7 |
| Formal Charge | 0 |
| Complexity | 46.100 |
| Isotope Atom Count | 5 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |