Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
P404854-1g
|
1g |
3
|
$120.90
|
|
|
P404854-5g
|
5g |
2
|
$422.90
|
|
| Synonyms | ethoxydimethyl(perfluorophenyl)silane | Dimethyl(2,3,4,5,6-pentafluorophenyl)silyl ethyl ether | Benzene,1-(ethoxydimethylsilyl)-2,3,4,5,6-pentafluoro- | 2-METHOXY-4,6-DI(TRIFLUOROMETHYL)BENZOICACID | Pentafluorophenylethoxydimethylsilane, >/=95% | T72866 |
|---|---|
| Specifications & Purity | ≥95% |
| Storage Temp | Argon charged |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Halobenzenes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Fluorobenzenes |
| Alternative Parents | Alkylarylsilanes Aryl fluorides Silyl ethers Organoheterosilanes Organic metalloid salts Organooxygen compounds Organofluorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Alkylarylsilane - Fluorobenzene - Aryl halide - Aryl fluoride - Silyl ether - Organoheterosilane - Organic metalloid salt - Organic oxygen compound - Hydrocarbon derivative - Organic salt - Organosilicon compound - Organooxygen compound - Organofluoride - Organohalogen compound - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as fluorobenzenes. These are compounds containing one or more fluorine atoms attached to a benzene ring. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 504759137 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504759137 |
| IUPAC Name | ethoxy-dimethyl-(2,3,4,5,6-pentafluorophenyl)silane |
| INCHI | InChI=1S/C10H11F5OSi/c1-4-16-17(2,3)10-8(14)6(12)5(11)7(13)9(10)15/h4H2,1-3H3 |
| InChIKey | HOENFMGYUBYVDH-UHFFFAOYSA-N |
| Smiles | CCO[Si](C)(C)C1=C(C(=C(C(=C1F)F)F)F)F |
| Isomeric SMILES | CCO[Si](C)(C)C1=C(C(=C(C(=C1F)F)F)F)F |
| PubChem CID | 523441 |
| Molecular Weight | 270.27 |
| Reaxy-Rn | 2991760 |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Jul 22, 2023 | P404854 | |
| Certificate of Analysis | Jul 22, 2023 | P404854 | |
| Certificate of Analysis | Jul 22, 2023 | P404854 | |
| Certificate of Analysis | Jul 22, 2023 | P404854 |
| Sensitivity | Moisture Sensitive |
|---|---|
| Refractive Index | 1.43 |
| Flash Point(°C) | 95 °C |
| Molecular Weight | 270.270 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 3 |
| Exact Mass | 270.05 Da |
| Monoisotopic Mass | 270.05 Da |
| Topological Polar Surface Area | 9.200 Ų |
| Heavy Atom Count | 17 |
| Formal Charge | 0 |
| Complexity | 249.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |