Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
P118402-1.2ml
|
1.2ml |
Available within 4-8 weeks(?)
Items will be manufactured post-order and can take 4-8 weeks. Thank you for your patience!
|
$210.90
|
|
| Synonyms | 2,2',4,4'-TETRACHLOROBIPHENYL | 2437-79-8 | PCB 47 | 1,1'-Biphenyl, 2,2',4,4'-tetrachloro- | 2,4,2',4'-Tetrachlorobiphenyl | Biphenyl, 2,2',4,4'-tetrachloro- | 2,2',4,4'-Tetrachlorodiphenyl | 2,2',4,4'-Tetrachloro-1,1'-biphenyl | EINECS 219-444-3 | 2,4-dichloro-1-(2,4-dich |
|---|---|
| Specifications & Purity | analytical standard, 100ug/mL in methanol |
| Shipped In | Normal |
| Grade | analytical standard |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Biphenyls and derivatives |
| Intermediate Tree Nodes | Chlorinated biphenyls |
| Direct Parent | Polychlorinated biphenyls |
| Alternative Parents | Dichlorobenzenes Aryl chlorides Organochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Polychlorinated biphenyl - 1,3-dichlorobenzene - Halobenzene - Chlorobenzene - Aryl halide - Aryl chloride - Hydrocarbon derivative - Organochloride - Organohalogen compound - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as polychlorinated biphenyls. These are organic compounds containing at least two chlorine atoms attached to either benzene ring of the biphenyl moiety. |
| External Descriptors | dichlorobenzene - tetrachlorobiphenyl |
|
|
|
| Activity Type | Relation | Activity value | Units | Action Type | Journal | PubMed Id | doi | Assay Aladdin ID |
|---|
| Mechanism of Action | Action Type | target ID | Target Name | Target Type | Target Organism | Binding Site Name | References |
|---|
| IUPAC Name | 2,4-dichloro-1-(2,4-dichlorophenyl)benzene |
|---|---|
| INCHI | InChI=1S/C12H6Cl4/c13-7-1-3-9(11(15)5-7)10-4-2-8(14)6-12(10)16/h1-6H |
| InChIKey | QORAVNMWUNPXAO-UHFFFAOYSA-N |
| Smiles | C1=CC(=C(C=C1Cl)Cl)C2=C(C=C(C=C2)Cl)Cl |
| Isomeric SMILES | C1=CC(=C(C=C1Cl)Cl)C2=C(C=C(C=C2)Cl)Cl |
| WGK Germany | WGK 3 |
| UN Number | 1230 |
| Packing Group | II |
| Molecular Weight | 292.00 |
| Reaxy-Rn | 2052543 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2052543&ln= |
| Molecular Weight | 292.000 g/mol |
|---|---|
| XLogP3 | 6.300 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 0 |
| Rotatable Bond Count | 1 |
| Exact Mass | 291.919 Da |
| Monoisotopic Mass | 289.922 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 209.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |