Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
A100461-5g
|
5g |
1
|
$28.90
|
|
| Synonyms | (O-AMINOPHENYL)ARSONIC ACID | 2-Arsanilic acid | EN300-19720 | UNII-4P7T2PH7DL | Q27260326 | SCHEMBL3264637 | 2-Aminophenylarsonic acid | AKOS009031463 | NSC12611 | NSC-12611 | 2-Aminobenzinearsonic acid | o-Arsanilic acid | J-013333 | o-Arsanilic acid, 9 |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Protected from light,Store at -20°C,Argon charged |
| Shipped In |
Ice chest + Ice pads This product requires cold chain shipping. Ground and other economy services are not available. |
| Product Description |
product describtion: o-Arsanilic Acid is an organoarsenic compound. o-Arsanilic Acid is a highly toxic contaminant and can be found in plants growing in contaminated soil. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Aniline and substituted anilines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Aniline and substituted anilines |
| Alternative Parents | Pentaorganoarsanes Oxygen-containing organoarsenic compounds Organic metalloid salts Primary amines Organopnictogen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Aniline or substituted anilines - Pentaorganoarsane - Oxygen-containing organoarsenic compound - Organic metalloid salt - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Organic oxide - Hydrocarbon derivative - Organic salt - Primary amine - Organonitrogen compound - Organoarsenic compound - Amine - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as aniline and substituted anilines. These are organic compounds containing an aminobenzene moiety. |
| External Descriptors | Not available |
|
|
|
| Mechanism of Action | Action Type | target ID | Target Name | Target Type | Target Organism | Binding Site Name | References |
|---|
| IUPAC Name | (2-aminophenyl)arsonic acid |
|---|---|
| INCHI | InChI=1S/C6H8AsNO3/c8-6-4-2-1-3-5(6)7(9,10)11/h1-4H,8H2,(H2,9,10,11) |
| InChIKey | LQCOCUQCZYAYQK-UHFFFAOYSA-N |
| Smiles | C1=CC=C(C(=C1)N)[As](=O)(O)O |
| Isomeric SMILES | C1=CC=C(C(=C1)N)[As](=O)(O)O |
| WGK Germany | 3 |
| UN Number | 3465 |
| Packing Group | III |
| Molecular Weight | 217.05 |
| Beilstein | 16(1)463 |
| Reaxy-Rn | 2937145 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2937145&ln= |
| Solubility | Easily soluble in water, ethanol, and acid, soluble in methanol, glacial acetic acid, and soluble in ether. |
|---|---|
| Sensitivity | Light sensitive.Moisture sensitive |
| Melt Point(°C) | 153°C |
| Molecular Weight | 217.050 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 1 |
| Exact Mass | 216.972 Da |
| Monoisotopic Mass | 216.972 Da |
| Topological Polar Surface Area | 83.600 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 179.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Gao Xiao, Jun Zhang, Mingzhu Zheng, Liyin Chen, Samson Afewerki, Manna Dai, Junling Guo. (2025) High-throughput continuous microfluidic magnifiable manufactured microstructured MOFs-mediated micropollutants mitigation (M7). SEPARATION AND PURIFICATION TECHNOLOGY, 362 (131931). |