Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
Basic Description
| Specifications & Purity | ≥98% |
|---|
Taxonomic Classification
Taxonomy Tree
-
Kingdom
Organic compounds
-
Superclass
Organohalogen compounds
- Class Organoiodides
-
Superclass
Organohalogen compounds
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organohalogen compounds |
| Class | Organoiodides |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Organoiodides |
| Alternative Parents | Organofluorides Hydrocarbon derivatives Alkyl iodides Alkyl fluorides |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Hydrocarbon derivative - Organoiodide - Organofluoride - Alkyl iodide - Alkyl halide - Alkyl fluoride - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as organoiodides. These are compounds containing a chemical bond between a carbon atom and an iodine atom. |
| External Descriptors | Not available |
|
|
|
Names and Identifiers
| IUPAC Name | 1,1,1,2,2,3,4,4,4-nonafluoro-3-iodobutane |
|---|---|
| INCHI | InChI=1S/C4F9I/c5-1(6,3(8,9)10)2(7,14)4(11,12)13 |
| InChIKey | FBJVLVWUMYWJMY-UHFFFAOYSA-N |
| Smiles | C(C(C(F)(F)F)(F)I)(C(F)(F)F)(F)F |
| Isomeric SMILES | C(C(C(F)(F)F)(F)I)(C(F)(F)F)(F)F |
| PubChem CID | 2775165 |
| Molecular Weight | 345.93 |
Certificates（CoA,COO,BSE/TSE and Analysis Chart)
C of A & Other Certificates(BSE/TSE, COO):
Analytical Chart:
Chemical and Physical Properties
| Boil Point(°C) | 65.5 |
|---|---|
| Molecular Weight | 345.930 g/mol |
| XLogP3 | 4.100 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 9 |
| Rotatable Bond Count | 1 |
| Exact Mass | 345.89 Da |
| Monoisotopic Mass | 345.89 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 214.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
Solution Calculators
Reviews
Customer Reviews
Remind me later