Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
N755806-100ml
|
100ml |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$41.90
|
|
| Specifications & Purity | suitable for microbiology |
|---|---|
| Storage Temp | Room temperature |
| Shipped In | Normal |
| Grade | suitable for microbiology |
| Product Description |
α-Naphtylamine and sulfanilic acid are used for detection of nitrate reduction by bacteria. Organisms containing nitrate reductase reduce nitrate to nitrite, which forms a diazonium salt with sulfanilic acid and reacts with α-naphtylamine to form a red azo dye. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Naphthalenes |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Naphthalenes |
| Alternative Parents | Primary amines Organopnictogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic homopolycyclic compounds |
| Substituents | Naphthalene - Organic nitrogen compound - Organopnictogen compound - Hydrocarbon derivative - Primary amine - Organonitrogen compound - Amine - Aromatic homopolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as naphthalenes. These are compounds containing a naphthalene moiety, which consists of two fused benzene rings. |
| External Descriptors | naphthylamine |
|
|
|
| IUPAC Name | naphthalen-1-amine |
|---|---|
| INCHI | InChI=1S/C10H9N/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-7H,11H2 |
| InChIKey | RUFPHBVGCFYCNW-UHFFFAOYSA-N |
| Smiles | C1=CC=C2C(=C1)C=CC=C2N |
| Isomeric SMILES | C1=CC=C2C(=C1)C=CC=C2N |
| WGK Germany | 2 |
| RTECS | QM1400000 |
| UN Number | 2077 |
| Packing Group | III |
| Molecular Weight | 143.19 |
| Beilstein | 386133 |
| Reaxy-Rn | 386133 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=386133&ln= |
| Flash Point(°F) | 314.6 °F |
|---|---|
| Flash Point(°C) | 157℃ |
| Boil Point(°C) | 301°C |
| Melt Point(°C) | 50°C |
| Molecular Weight | 143.180 g/mol |
| XLogP3 | 2.200 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 0 |
| Exact Mass | 143.073 Da |
| Monoisotopic Mass | 143.073 Da |
| Topological Polar Surface Area | 26.000 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 133.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Yali Yang, Jia Chen, Xiaojing Liang, Bei Liu, Kaijun Quan, Xiuhui Liu, Hongdeng Qiu. (2024) Adjustable chromatographic performance of silica-based mixed-mode stationary phase through the control of co-grafting amounts of imidazole and C18 chain. JOURNAL OF CHROMATOGRAPHY A, 1722 (464889). |
| 2. Yanyan Chen, Hao Deng, Pengliang Liang, Heng Yang, Long Jiang, Jing Yin, Jia Liu, Shuying Shi, Huiqiang Liu, Yuxiang Li, Ying Xiong. (2024) Antagonistic Effect of Nitrate Conversion on Photocatalytic Reduction of Aqueous Pertechnetate and Perrhenate. ENVIRONMENTAL SCIENCE & TECHNOLOGY, 58 (49): (21882-21892). |
| 3. Xuening Chen, Changkun Chen, Chengmiao Luo, Jianyong Liu, Zhonghui Lin. (2024) Discovery of UMI-77 as a novel Ku70/80 inhibitor sensitizing cancer cells to DNA damaging agents in vitro and in vivo. EUROPEAN JOURNAL OF PHARMACOLOGY, (176647). |
| 4. Bolun Mei, Yueru Wang, Jianhua Zhou, Xingchuan Yang, Yi Yu, Li Xu, Guoji Liu. (2024) Experimental and simulation study on the solubility of 1-naphthylamine in twelve neat solvents. JOURNAL OF MOLECULAR LIQUIDS, 408 (124760). |
| 5. Cheng Yang, Yanmei Shi, Lixin Li, Zhihong Chen, Di Zhao, Weixia Zhu, Kai Hu. (2024) Facile preparation of novel magnetic metal-organic frameworks/Ti3C2Tx composite for efficiently removal of bisphenol A from water samples. JOURNAL OF INDUSTRIAL AND ENGINEERING CHEMISTRY, |
| 6. Chunning Chen, Jiaqi Liu, Jiaxin Lu, Yalei Wang, Jingtong Zhai, Hongkun Zhao, Nan Lu. (2024) In Situ Collection and SERS Detection of Nitrite in Exhalations on Facemasks Based on Wettability Differences. ACS Sensors, 9 (7): (3680-3688). |
| 7. Xianqing Huang, Wenxin Li, Jing Wang, Qian Li, Yue Shen, Yongxia Cheng, Tiange Li, Tianlin Wang, Yinping Wang, Lianjun Song, Yan Ma. (2024) NaCl stress on physio-biochemical, phenolics synthesis and antioxidant system of pea (Pisum sativum L.) sprouts. LWT-FOOD SCIENCE AND TECHNOLOGY, 210 (116821). |
| 8. Zhaofen Xu, Lingfang Tang, Yuanyi Zhou, Gang Lu, Haojie Dong, Mingshan Zhu. (2024) Utilizing the immanent chloride ions in wastewater for reactive chlorine species photogeneration towards effective ammonia nitrogen removal. CHEMICAL ENGINEERING JOURNAL, 493 (152589). |