Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
N190822-50mg
|
50mg |
8
|
$9.90
|
|
|
N190822-250mg
|
250mg |
4
|
$27.90
|
|
| Synonyms | N-(4-BROMO-2,6-DICHLOROPHENYL)ACETAMIDE | 13953-09-8 | Acetamide,N-(4-bromo-2,6-dichlorophenyl)- | Acetamide, N-(4-bromo-2,6-dichlorophenyl)- | DTXSID40504658 | MFCD08703152 | AKOS008969096 | DS-16273 | CS-0153988 | C72576 |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Anilides |
| Intermediate Tree Nodes | Acetanilides - Haloacetanilides |
| Direct Parent | O-haloacetanilides |
| Alternative Parents | P-haloacetanilides N-acetylarylamines Dichlorobenzenes Bromobenzenes Aryl chlorides Aryl bromides Acetamides Secondary carboxylic acid amides Organochlorides Organobromides Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | O-haloacetanilide - P-haloacetanilide - N-acetylarylamine - N-arylamide - 1,3-dichlorobenzene - Bromobenzene - Chlorobenzene - Halobenzene - Aryl bromide - Aryl chloride - Aryl halide - Acetamide - Secondary carboxylic acid amide - Carboxamide group - Carboxylic acid derivative - Organic nitrogen compound - Organohalogen compound - Organobromide - Organochloride - Organonitrogen compound - Organooxygen compound - Carbonyl group - Hydrocarbon derivative - Organic oxide - Organic oxygen compound - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as o-haloacetanilides. These are organic compounds containing an acetamide group conjugated to a phenyl group, which is in turn ortho-substituted with a halogen atom. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 504767175 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504767175 |
| IUPAC Name | N-(4-bromo-2,6-dichlorophenyl)acetamide |
| INCHI | InChI=1S/C8H6BrCl2NO/c1-4(13)12-8-6(10)2-5(9)3-7(8)11/h2-3H,1H3,(H,12,13) |
| InChIKey | VLEHCDVPBFIQSK-UHFFFAOYSA-N |
| Smiles | CC(=O)NC1=C(C=C(C=C1Cl)Br)Cl |
| Isomeric SMILES | CC(=O)NC1=C(C=C(C=C1Cl)Br)Cl |
| Molecular Weight | 282.95 |
| Reaxy-Rn | 3092451 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=3092451&ln= |
| Molecular Weight | 282.950 g/mol |
|---|---|
| XLogP3 | 2.000 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 1 |
| Exact Mass | 280.901 Da |
| Monoisotopic Mass | 280.901 Da |
| Topological Polar Surface Area | 29.100 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 191.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |