Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
N183477-25g
|
25g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$3,427.90
|
|
| Synonyms | N-(2-acetyl-4-bromophenyl)acetamide | 29124-64-9 | N-(2-acetyl-4-bromo-phenyl)acetamide | N-(2-Acetyl-4-bromo-phenyl)-acetamide | 2-Acetyl-4-bromoacetanilide | SCHEMBL796957 | DTXSID50332626 | SGHNZIRCTDCQPX-UHFFFAOYSA-N | AMY32323 | MFCD00460457 | AKOS016006911 | MB01207 | AC-2 |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Class | Organooxygen compounds |
| Subclass | Carbonyl compounds |
| Intermediate Tree Nodes | Ketones - Aryl ketones - Phenylketones |
| Direct Parent | Alkyl-phenylketones |
| Alternative Parents | P-haloacetanilides N-acetylarylamines Acetophenones Benzoyl derivatives Aryl alkyl ketones Bromobenzenes Aryl bromides Vinylogous amides Acetamides Secondary carboxylic acid amides Organopnictogen compounds Organobromides Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Alkyl-phenylketone - P-haloacetanilide - Haloacetanilide - Acetanilide - Anilide - Acetophenone - N-acetylarylamine - Aryl alkyl ketone - N-arylamide - Benzoyl - Halobenzene - Bromobenzene - Aryl halide - Benzenoid - Monocyclic benzene moiety - Aryl bromide - Acetamide - Vinylogous amide - Secondary carboxylic acid amide - Carboxamide group - Carboxylic acid derivative - Organopnictogen compound - Organobromide - Organonitrogen compound - Organic nitrogen compound - Hydrocarbon derivative - Organic oxide - Organohalogen compound - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as alkyl-phenylketones. These are aromatic compounds containing a ketone substituted by one alkyl group, and a phenyl group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | N-(2-acetyl-4-bromophenyl)acetamide |
|---|---|
| INCHI | InChI=1S/C10H10BrNO2/c1-6(13)9-5-8(11)3-4-10(9)12-7(2)14/h3-5H,1-2H3,(H,12,14) |
| InChIKey | SGHNZIRCTDCQPX-UHFFFAOYSA-N |
| Smiles | CC(=O)C1=C(C=CC(=C1)Br)NC(=O)C |
| Isomeric SMILES | CC(=O)C1=C(C=CC(=C1)Br)NC(=O)C |
| Molecular Weight | 256.1 |
| Reaxy-Rn | 2806312 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2806312&ln= |
| Molecular Weight | 256.100 g/mol |
|---|---|
| XLogP3 | 2.200 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 2 |
| Exact Mass | 254.989 Da |
| Monoisotopic Mass | 254.989 Da |
| Topological Polar Surface Area | 46.200 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 242.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |