Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
M333037-25mg
|
25mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$89.90
|
|
|
M333037-100mg
|
100mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$285.90
|
|
| Synonyms | 1,2-Benzenedicarboxylicacid,1-heptyl ester | Phthalic acid mono-n-heptyl ester | 2-(Heptyloxycarbonyl)benzoic acid | DTXSID00947421 | monoheptyl phthalate | AI3-06033 | Phthalic acid, monoheptyl ester | EINECS 272-737-8 | 2-heptoxycarbonylbenzoic acid | 1 |
|---|---|
| Specifications & Purity | ≥95% |
| Storage Temp | Store at 2-8°C |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
| Product Description |
Monoheptyl Phthalate is a phthalate monoester and the metabolite of Dibutyl Phthalate (D429495), a phthalate metabolite with genotoxic effect. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Benzoic acids and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Benzoic acid esters |
| Alternative Parents | Benzoic acids Benzoyl derivatives Dicarboxylic acids and derivatives Carboxylic acid esters Carboxylic acids Organooxygen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Benzoate ester - Benzoic acid - Benzoyl - Dicarboxylic acid or derivatives - Carboxylic acid ester - Carboxylic acid - Carboxylic acid derivative - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as benzoic acid esters. These are ester derivatives of benzoic acid. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2-heptoxycarbonylbenzoic acid |
|---|---|
| INCHI | InChI=1S/C15H20O4/c1-2-3-4-5-8-11-19-15(18)13-10-7-6-9-12(13)14(16)17/h6-7,9-10H,2-5,8,11H2,1H3,(H,16,17) |
| InChIKey | DMVQNBGDYPFJCC-UHFFFAOYSA-N |
| Smiles | CCCCCCCOC(=O)C1=CC=CC=C1C(=O)O |
| Isomeric SMILES | CCCCCCCOC(=O)C1=CC=CC=C1C(=O)O |
| Molecular Weight | 264.32 |
| Reaxy-Rn | 2586436 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2586436&ln= |
| Solubility | DMSO (Sparingly), Methanol (Slightly) |
|---|---|
| Molecular Weight | 264.320 g/mol |
| XLogP3 | 4.800 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 9 |
| Exact Mass | 264.136 Da |
| Monoisotopic Mass | 264.136 Da |
| Topological Polar Surface Area | 63.600 Ų |
| Heavy Atom Count | 19 |
| Formal Charge | 0 |
| Complexity | 288.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |