Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
M769955-100mg
|
100mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$350.90
|
|
| Specifications & Purity | analytical standard, ≥99%(GC) |
|---|---|
| Storage Temp | Store at -20°C |
| Shipped In |
Ice chest + Ice pads This product requires cold chain shipping. Ground and other economy services are not available. |
| Grade | analytical standard |
| Product Description |
It can be used as a reference standard oil mixture for the determination of fatty acids and long chain alcohols of wax esters using GC/MS analysis. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Lipids and lipid-like molecules |
| Class | Fatty Acyls |
| Subclass | Fatty acid esters |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Fatty acid methyl esters |
| Alternative Parents | Methyl esters Monocarboxylic acids and derivatives Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Fatty acid methyl ester - Methyl ester - Carboxylic acid ester - Monocarboxylic acid or derivatives - Carboxylic acid derivative - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Carbonyl group - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as fatty acid methyl esters. These are compounds containing a fatty acid that is esterified with a methyl group. They have the general structure RC(=O)OR', where R=fatty aliphatic tail or organyl group and R'=methyl group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | methyl (Z)-tetracos-15-enoate |
|---|---|
| INCHI | InChI=1S/C25H48O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25(26)27-2/h10-11H,3-9,12-24H2,1-2H3/b11-10- |
| InChIKey | AINIZSBLAFHZCP-KHPPLWFESA-N |
| Smiles | CCCCCCCCC=CCCCCCCCCCCCCCC(=O)OC |
| Isomeric SMILES | CCCCCCCC/C=C\CCCCCCCCCCCCCC(=O)OC |
| WGK Germany | 3 |
| PubChem CID | 5364841 |
| Molecular Weight | 380.65 |
| Beilstein | 1728860 |
| Molecular Weight | 380.600 g/mol |
|---|---|
| XLogP3 | 10.800 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 22 |
| Exact Mass | 380.365 Da |
| Monoisotopic Mass | 380.365 Da |
| Topological Polar Surface Area | 26.300 Ų |
| Heavy Atom Count | 27 |
| Formal Charge | 0 |
| Complexity | 322.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 1 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 1 |
| Covalently-Bonded Unit Count | 1 |