Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
M177307-250mg
|
250mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$217.90
|
|
Discover methyl 5-aminopyrimidine-2-carboxylate by Aladdin Scientific in 97% for only $217.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | Methyl 5-aminopyrimidine-2-carboxylate | 73418-88-9 | SCHEMBL9950882 | DTXSID70442978 | NYYBCNDGMLXGQQ-UHFFFAOYSA-N | 5-amino-2-methoxycarbonylpyrimidine | AMY11783 | YCA41888 | MFCD08234876 | AKOS005137933 | PB10524 | AS-41911 | CS-0049006 | FT-0756257 | EN300-4285588 | 5-amino-pyrim |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Diazines |
| Subclass | Pyrimidines and pyrimidine derivatives |
| Intermediate Tree Nodes | Pyrimidinecarboxylic acids and derivatives |
| Direct Parent | Pyrimidinecarboxylic acids |
| Alternative Parents | Aminopyrimidines and derivatives Methyl esters Heteroaromatic compounds Amino acids and derivatives Azacyclic compounds Primary amines Organooxygen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Pyrimidine-2-carboxylic acid - Aminopyrimidine - Heteroaromatic compound - Methyl ester - Amino acid or derivatives - Carboxylic acid ester - Carboxylic acid derivative - Azacycle - Primary amine - Organooxygen compound - Organonitrogen compound - Organic oxide - Amine - Organic oxygen compound - Hydrocarbon derivative - Organic nitrogen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as pyrimidinecarboxylic acids. These are pyrimidines with a structure containing a carboxyl group attached to the pyrimidine ring. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | methyl 5-aminopyrimidine-2-carboxylate |
|---|---|
| INCHI | InChI=1S/C6H7N3O2/c1-11-6(10)5-8-2-4(7)3-9-5/h2-3H,7H2,1H3 |
| InChIKey | NYYBCNDGMLXGQQ-UHFFFAOYSA-N |
| Smiles | COC(=O)C1=NC=C(C=N1)N |
| Molecular Weight | 153.140 g/mol |
|---|---|
| XLogP3 | -1.400 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 2 |
| Exact Mass | 153.054 Da |
| Monoisotopic Mass | 153.054 Da |
| Topological Polar Surface Area | 78.100 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 143.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |