Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
M191650-50mg
|
50mg |
3
|
$9.90
|
|
|
M191650-250mg
|
250mg |
2
|
$18.90
|
|
| Synonyms | Methyl 4-fluoropyrazolo[1,5-a]pyridine-3-carboxylate | 1802489-64-0 | Pyrazolo[1,5-a]pyridine-3-carboxylic acid, 4-fluoro-, methyl ester | DTXSID901165997 | MFCD28975311 | AKOS025290477 | DS-9551 | CS-0042881 | C73443 | Methyl4-fluoropyrazolo[1,5-a]pyridine-3-carboxylate |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyrazolopyridines |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Pyrazolopyridines |
| Alternative Parents | Pyrazole carboxylic acids and derivatives Pyridines and derivatives Aryl fluorides Vinylogous amides Methyl esters Heteroaromatic compounds Azacyclic compounds Organooxygen compounds Organonitrogen compounds Organofluorides Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Pyrazolopyridine - Pyrazole-4-carboxylic acid or derivatives - Aryl fluoride - Aryl halide - Pyridine - Azole - Heteroaromatic compound - Pyrazole - Vinylogous amide - Methyl ester - Carboxylic acid ester - Carboxylic acid derivative - Azacycle - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Organofluoride - Organohalogen compound - Organic oxide - Organic oxygen compound - Organic nitrogen compound - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as pyrazolopyridines. These are compounds containing a pyrazolopyridine skeleton, which consists of a pyrazole fused to a pyridine. Pyrazole is 5-membered ring consisting of three carbon atoms and two adjacent nitrogen centers. Pyridine is a 6-membered ring with four carbon and one nitrogen atoms. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 504772677 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504772677 |
| IUPAC Name | methyl 4-fluoropyrazolo[1,5-a]pyridine-3-carboxylate |
| INCHI | InChI=1S/C9H7FN2O2/c1-14-9(13)6-5-11-12-4-2-3-7(10)8(6)12/h2-5H,1H3 |
| InChIKey | IAJNMQKICSFNKH-UHFFFAOYSA-N |
| Smiles | COC(=O)C1=C2C(=CC=CN2N=C1)F |
| Isomeric SMILES | COC(=O)C1=C2C(=CC=CN2N=C1)F |
| PubChem CID | 91825765 |
| Molecular Weight | 194.16 |
| Molecular Weight | 194.160 g/mol |
|---|---|
| XLogP3 | 1.000 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 2 |
| Exact Mass | 194.049 Da |
| Monoisotopic Mass | 194.049 Da |
| Topological Polar Surface Area | 43.600 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 237.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |