Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
M178786-25g
|
25g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,175.90
|
|
| Synonyms | METHYL 4-CHLORO-8-METHYLQUINOLINE-2-CARBOXYLATE | 1020101-33-0 | methyl4-chloro-8-methylquinoline-2-carboxylate | SCHEMBL3281565 | DTXSID90675105 | VQB10133 | MFCD12913953 | AKOS012682843 | SB69115 | BS-19152 | CS-0212225 | A896968 | 2-Quinolinecarboxylic acid, 4-chloro-8-methyl |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Quinolines and derivatives |
| Subclass | Haloquinolines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Chloroquinolines |
| Alternative Parents | Pyridinecarboxylic acids Benzenoids Aryl chlorides Methyl esters Heteroaromatic compounds Azacyclic compounds Organooxygen compounds Organonitrogen compounds Organochlorides Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Chloroquinoline - Pyridine carboxylic acid - Pyridine carboxylic acid or derivatives - Aryl chloride - Aryl halide - Benzenoid - Pyridine - Heteroaromatic compound - Methyl ester - Carboxylic acid ester - Carboxylic acid derivative - Azacycle - Organooxygen compound - Organonitrogen compound - Organochloride - Organohalogen compound - Organic oxide - Organic oxygen compound - Hydrocarbon derivative - Organic nitrogen compound - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as chloroquinolines. These are compounds containing a quinoline moiety, which carries one or more chlorine atoms. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | methyl 4-chloro-8-methylquinoline-2-carboxylate |
|---|---|
| INCHI | InChI=1S/C12H10ClNO2/c1-7-4-3-5-8-9(13)6-10(12(15)16-2)14-11(7)8/h3-6H,1-2H3 |
| InChIKey | FFRCXTXPLHQRFN-UHFFFAOYSA-N |
| Smiles | CC1=C2C(=CC=C1)C(=CC(=N2)C(=O)OC)Cl |
| Isomeric SMILES | CC1=C2C(=CC=C1)C(=CC(=N2)C(=O)OC)Cl |
| Molecular Weight | 235.7 |
| Reaxy-Rn | 45786119 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=45786119&ln= |
| Molecular Weight | 235.660 g/mol |
|---|---|
| XLogP3 | 3.400 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 2 |
| Exact Mass | 235.04 Da |
| Monoisotopic Mass | 235.04 Da |
| Topological Polar Surface Area | 39.200 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 272.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |