Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
M181138-100g
|
100g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,958.90
|
|
Discover Methyl 4-amino-3-(diethylamino)benzoate by Aladdin Scientific in 97% for only $1,958.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | Methyl 4-amino-3-(diethylamino)benzoate | 1314987-87-5 | 4-(Methoxycarbonyl)-2,2-diethylbenzene-1,2-diamine | Methyl4-amino-3-(diethylamino)benzoate | DTXSID70716525 | MFCD19684091 | AKOS015888626 | SB77355 | BS-20541 | CS-0208999 | A888426 | Benzoic acid, 4-amino-3-(diethylam |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Benzoic acids and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Benzoic acid esters |
| Alternative Parents | Aminobenzoic acids and derivatives Dialkylarylamines Benzoyl derivatives Aniline and substituted anilines Methyl esters Amino acids and derivatives Monocarboxylic acids and derivatives Primary amines Organopnictogen compounds Organooxygen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Aminobenzoic acid or derivatives - Benzoate ester - Benzoyl - Tertiary aliphatic/aromatic amine - Dialkylarylamine - Aniline or substituted anilines - Methyl ester - Tertiary amine - Amino acid or derivatives - Carboxylic acid ester - Monocarboxylic acid or derivatives - Carboxylic acid derivative - Organic nitrogen compound - Primary amine - Organooxygen compound - Organonitrogen compound - Amine - Organic oxygen compound - Hydrocarbon derivative - Organic oxide - Organopnictogen compound - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as benzoic acid esters. These are ester derivatives of benzoic acid. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | methyl 4-amino-3-(diethylamino)benzoate |
|---|---|
| INCHI | InChI=1S/C12H18N2O2/c1-4-14(5-2)11-8-9(12(15)16-3)6-7-10(11)13/h6-8H,4-5,13H2,1-3H3 |
| InChIKey | ILZMGHGPYNRXCS-UHFFFAOYSA-N |
| Smiles | CCN(CC)C1=C(C=CC(=C1)C(=O)OC)N |
| Isomeric SMILES | CCN(CC)C1=C(C=CC(=C1)C(=O)OC)N |
| PubChem CID | 54758771 |
| Molecular Weight | 222.3 |
| Molecular Weight | 222.280 g/mol |
|---|---|
| XLogP3 | 1.900 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 5 |
| Exact Mass | 222.137 Da |
| Monoisotopic Mass | 222.137 Da |
| Topological Polar Surface Area | 55.600 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 229.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |