Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
M181351-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,618.90
|
|
| Synonyms | 1373232-44-0 | Methyl 3'-amino-3-fluoro-[1,1'-biphenyl]-4-carboxylate hydrochloride | Methyl 4-(3-aminophenyl)-2-fluorobenzoate hydrochloride | METHYL 4-(3-AMINOPHENYL)-2-FLUOROBENZOATE, HCL | methyl 4-(3-aminophenyl)-2-fluorobenzoate;hydrochloride | Methyl 4-(3-am |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Biphenyls and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Biphenyls and derivatives |
| Alternative Parents | Benzoic acid esters 2-halobenzoic acids and derivatives Benzoyl derivatives Aniline and substituted anilines Fluorobenzenes Aryl fluorides Vinylogous halides Methyl esters Amino acids and derivatives Primary amines Organooxygen compounds Organofluorides Organic oxides Hydrochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Biphenyl - Benzoate ester - Halobenzoic acid or derivatives - 2-halobenzoic acid or derivatives - Benzoic acid or derivatives - Aniline or substituted anilines - Benzoyl - Fluorobenzene - Halobenzene - Aryl fluoride - Aryl halide - Vinylogous halide - Methyl ester - Amino acid or derivatives - Carboxylic acid ester - Carboxylic acid derivative - Organofluoride - Organohalogen compound - Primary amine - Amine - Hydrochloride - Hydrocarbon derivative - Organic oxide - Organic oxygen compound - Organic nitrogen compound - Organonitrogen compound - Organooxygen compound - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as biphenyls and derivatives. These are organic compounds containing to benzene rings linked together by a C-C bond. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | methyl 4-(3-aminophenyl)-2-fluorobenzoate;hydrochloride |
|---|---|
| INCHI | InChI=1S/C14H12FNO2.ClH/c1-18-14(17)12-6-5-10(8-13(12)15)9-3-2-4-11(16)7-9;/h2-8H,16H2,1H3;1H |
| InChIKey | XGCWMHLJNLWDHO-UHFFFAOYSA-N |
| Smiles | COC(=O)C1=C(C=C(C=C1)C2=CC(=CC=C2)N)F.Cl |
| Isomeric SMILES | COC(=O)C1=C(C=C(C=C1)C2=CC(=CC=C2)N)F.Cl |
| PubChem CID | 70701219 |
| Molecular Weight | 281.7 |
| Molecular Weight | 281.710 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 3 |
| Exact Mass | 281.062 Da |
| Monoisotopic Mass | 281.062 Da |
| Topological Polar Surface Area | 52.300 Ų |
| Heavy Atom Count | 19 |
| Formal Charge | 0 |
| Complexity | 298.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |