Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
M114416-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$69.90
|
|
| Synonyms | Methyl undec-10-enoate | 111-81-9 | METHYL 10-UNDECENOATE | Methyl undecenate | 10-Undecenoic acid, methyl ester | Methyl undecenoate | Methyl 10-undecenate | 10-Undecenoic acid methyl ester | Undecenoic acid, methyl ester | Undecylenic acid methyl ester | Undecylenic acid, |
|---|---|
| Specifications & Purity | analytical standard |
| Storage Temp | Store at 2-8°C |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
| Grade | analytical standard |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Lipids and lipid-like molecules |
| Class | Fatty Acyls |
| Subclass | Fatty acid esters |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Fatty acid methyl esters |
| Alternative Parents | Methyl esters Monocarboxylic acids and derivatives Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Fatty acid methyl ester - Methyl ester - Carboxylic acid ester - Monocarboxylic acid or derivatives - Carboxylic acid derivative - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Carbonyl group - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as fatty acid methyl esters. These are compounds containing a fatty acid that is esterified with a methyl group. They have the general structure RC(=O)OR', where R=fatty aliphatic tail or organyl group and R'=methyl group. |
| External Descriptors | fatty acid methyl ester |
|
|
|
| Activity Type | Relation | Activity value | Units | Action Type | Journal | PubMed Id | doi | Assay Aladdin ID |
|---|
| Mechanism of Action | Action Type | target ID | Target Name | Target Type | Target Organism | Binding Site Name | References |
|---|
| IUPAC Name | methyl undec-10-enoate |
|---|---|
| INCHI | InChI=1S/C12H22O2/c1-3-4-5-6-7-8-9-10-11-12(13)14-2/h3H,1,4-11H2,2H3 |
| InChIKey | KISVAASFGZJBCY-UHFFFAOYSA-N |
| Smiles | COC(=O)CCCCCCCCC=C |
| Isomeric SMILES | COC(=O)CCCCCCCCC=C |
| WGK Germany | 3 |
| Molecular Weight | 198.3 |
| Reaxy-Rn | 1765394 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1765394&ln= |
| Refractive Index | 1.437 |
|---|---|
| Flash Point(°F) | >100 °C |
| Flash Point(°C) | >100°C |
| Boil Point(°C) | 245°C |
| Molecular Weight | 198.300 g/mol |
| XLogP3 | 4.200 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 10 |
| Exact Mass | 198.162 Da |
| Monoisotopic Mass | 198.162 Da |
| Topological Polar Surface Area | 26.300 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 152.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Jingjing Fan, Wei Liu, Lieshun Cai, Taoshan Jiang, Zhongkai Wang. (2023) Castor oil-based multi-functional monomers and their application in polyamide design. INDUSTRIAL CROPS AND PRODUCTS, 203 (117188). |
| 2. Haonan Li, Xiankun Wu, Min Li, Peng Chen, Jiale Zhang, Zhongkai Wang, Zhong Wang. (2023) Dynamic sustainable polyamide elastomer toward ultratough and fully recyclable self-healing ionic conductors. CHEMICAL ENGINEERING JOURNAL, 470 (144263). |
| 3. Xiankun Wu, Haonan Li, Peng Chen, Jiale Zhang, Ming Li, Shujun Zhao, Zhongkai Wang, Zhong Wang. (2023) Natural-silk-inspired design provides ultra-tough biobased structural adhesives with supercold tolerance. Journal of Materials Chemistry A, 11 (12): (6286-6298). |
| 4. Li Wang, Haihang Luo, Qiang Gao, Le Jiang, Zhenya Wang, Haojun Fan, Yi Chen, Jun Yan, Jun Xiang. (2023) The missing piece: Effect of dangling chains on the synthesis and properties of bio-based waterborne polyurethane. JOURNAL OF POLYMER SCIENCE, 61 (9): (748-760). |