Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
M105928-25ml
|
25ml |
6
|
$17.90
|
|
|
M105928-100ml
|
100ml |
3
|
$31.90
|
|
|
M105928-250ml
|
250ml |
Available within 4-8 weeks(?)
Items will be manufactured post-order and can take 4-8 weeks. Thank you for your patience!
|
$59.90
|
|
|
M105928-500ml
|
500ml |
2
|
$103.90
|
|
| Synonyms | Mesityl oxide, European Pharmacopoeia (EP) Reference Standard | Mesityloxyde | Acetone, isopropylidene- | Methyl 2,2-dimethylvinyl ketone | UNII-77LAC84669 | Mesityl oxide, suitable for neutral marker for measuring electroosmotic flow (EOF), ~98% | Mesity |
|---|---|
| Specifications & Purity | ≥90% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Class | Organooxygen compounds |
| Subclass | Carbonyl compounds |
| Intermediate Tree Nodes | Alpha,beta-unsaturated carbonyl compounds - Alpha,beta-unsaturated ketones |
| Direct Parent | Enones |
| Alternative Parents | Acryloyl compounds Ketones Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Enone - Acryloyl-group - Ketone - Organic oxide - Hydrocarbon derivative - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as enones. These are compounds containing the enone functional group, with the structure RC(=O)CR'. |
| External Descriptors | Oxygenated hydrocarbons |
|
|
|
| Mechanism of Action | Action Type | target ID | Target Name | Target Type | Target Organism | Binding Site Name | References |
|---|
| Pubchem Sid | 504751751 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504751751 |
| IUPAC Name | 4-methylpent-3-en-2-one |
| INCHI | InChI=1S/C6H10O/c1-5(2)4-6(3)7/h4H,1-3H3 |
| InChIKey | SHOJXDKTYKFBRD-UHFFFAOYSA-N |
| Smiles | CC(=CC(=O)C)C |
| Isomeric SMILES | CC(=CC(=O)C)C |
| WGK Germany | 1 |
| RTECS | SB4200000 |
| UN Number | 1229 |
| Packing Group | III |
| Molecular Weight | 98.14 |
| Beilstein | 1361550 |
| Reaxy-Rn | 1361550 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1361550&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Jul 18, 2023 | M105928 | |
| Certificate of Analysis | Jun 09, 2023 | M105928 | |
| Certificate of Analysis | Apr 13, 2023 | M105928 | |
| Certificate of Analysis | Apr 13, 2023 | M105928 | |
| Certificate of Analysis | Sep 15, 2022 | M105928 | |
| Certificate of Analysis | Oct 26, 2021 | M105928 | |
| Certificate of Analysis | Oct 26, 2021 | M105928 |
| Refractive Index | 1.442 |
|---|---|
| Flash Point(°F) | 31℃ |
| Flash Point(°C) | 31℃ |
| Boil Point(°C) | 129°C |
| Melt Point(°C) | -52.85°C |
| Molecular Weight | 98.140 g/mol |
| XLogP3 | 1.400 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 1 |
| Exact Mass | 98.0732 Da |
| Monoisotopic Mass | 98.0732 Da |
| Topological Polar Surface Area | 17.100 Ų |
| Heavy Atom Count | 7 |
| Formal Charge | 0 |
| Complexity | 96.700 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |