Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
M755528-100g
|
100g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$135.90
|
|
| Specifications & Purity | Ultra pure, ≥99%(T), zwitterionic buffer useful in pH range 5.5-6.7 |
|---|---|
| Storage Temp | Room temperature |
| Shipped In | Normal |
| Grade | Ultra pure |
| Product Description |
A zwitterionic buffer useful in the pH range of 5.5-6.5 (absorbance: <0.05 at 260 nm, 100 mM, H2O; pKa: 6.2 at 20°C). A zwitterionic buffer useful in the pH range of 5.5-6.7. Has a pKa of 6.10 at 25°C. Absorbance (100 mM, H2O, 260 nM):≤0.05. Application:
|
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Oxazinanes |
| Subclass | Morpholines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Morpholines |
| Alternative Parents | Sulfonyls Organosulfonic acids Alkanesulfonic acids Trialkylamines Oxacyclic compounds Dialkyl ethers Azacyclic compounds Organopnictogen compounds Organic zwitterions Organic sodium salts Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Morpholine - Organic sulfonic acid or derivatives - Organosulfonic acid or derivatives - Organosulfonic acid - Sulfonyl - Alkanesulfonic acid - Tertiary amine - Tertiary aliphatic amine - Dialkyl ether - Ether - Oxacycle - Azacycle - Organic alkali metal salt - Hydrocarbon derivative - Organic oxide - Organopnictogen compound - Organic oxygen compound - Organosulfur compound - Organooxygen compound - Organonitrogen compound - Amine - Organic nitrogen compound - Organic zwitterion - Organic salt - Organic sodium salt - Aliphatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as morpholines. These are organic compounds containing a morpholine moiety, which consists of a six-member aliphatic saturated ring with the formula C4H9NO, where the oxygen and nitrogen atoms lie at positions 1 and 4, respectively. |
| External Descriptors | organic sodium salt |
|
|
|
| IUPAC Name | sodium;2-morpholin-4-ylethanesulfonate |
|---|---|
| INCHI | InChI=1S/C6H13NO4S.Na/c8-12(9,10)6-3-7-1-4-11-5-2-7;/h1-6H2,(H,8,9,10);/q;+1/p-1 |
| InChIKey | IRHWMYKYLWNHTL-UHFFFAOYSA-M |
| Smiles | C1COCCN1CCS(=O)(=O)[O-].[Na+] |
| Isomeric SMILES | C1COCCN1CCS(=O)(=O)[O-].[Na+] |
| WGK Germany | 1 |
| Molecular Weight | 217.22 |
| Beilstein | 3765682 |
| Reaxy-Rn | 3765682 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=3765682&ln= |
| Solubility | water: 5 mg/mL |
|---|---|
| Molecular Weight | 217.220 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 3 |
| Exact Mass | 217.038 Da |
| Monoisotopic Mass | 217.038 Da |
| Topological Polar Surface Area | 78.100 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 219.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |