Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
M409482-1ml
|
1ml |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$114.90
|
|
| Synonyms | MCPA-isooctyl | MCPA-isooctyl [ISO] | mcpa isooctyl | MCPA ISOOCTYL ESTER | MCPAIsooctylEster | 26544-20-7 | 1238777-58-6 | (4-Chloro-2-methylphenoxy)acetic acid isooctyl ester | ZLQ3JF4KCB | Acetic acid, (4-chloro-2-methylphenoxy)-, isooctyl ester | ((4-Chloro-o-tolyl)oxy)a |
|---|---|
| Specifications & Purity | 100μg/mL in Acetonitrile |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Phenoxyacetic acid derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phenoxyacetic acid derivatives |
| Alternative Parents | Phenoxy compounds Phenol ethers Toluenes Chlorobenzenes Alkyl aryl ethers Aryl chlorides Carboxylic acid esters Monocarboxylic acids and derivatives Organochlorides Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Phenoxyacetate - Phenoxy compound - Phenol ether - Alkyl aryl ether - Toluene - Chlorobenzene - Halobenzene - Aryl chloride - Aryl halide - Carboxylic acid ester - Carboxylic acid derivative - Ether - Monocarboxylic acid or derivatives - Organochloride - Organooxygen compound - Organic oxygen compound - Carbonyl group - Hydrocarbon derivative - Organohalogen compound - Organic oxide - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as phenoxyacetic acid derivatives. These are compounds containing an anisole where the methane group is linked to an acetic acid or a derivative. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 6-methylheptyl 2-(4-chloro-2-methylphenoxy)acetate |
|---|---|
| INCHI | InChI=1S/C17H25ClO3/c1-13(2)7-5-4-6-10-20-17(19)12-21-16-9-8-15(18)11-14(16)3/h8-9,11,13H,4-7,10,12H2,1-3H3 |
| InChIKey | PDIYKJRLQHHRAG-UHFFFAOYSA-N |
| Smiles | CC1=C(C=CC(=C1)Cl)OCC(=O)OCCCCCC(C)C |
| Isomeric SMILES | CC1=C(C=CC(=C1)Cl)OCC(=O)OCCCCCC(C)C |
| Molecular Weight | 312.8 |
| Reaxy-Rn | 23084186 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=23084186&ln= |
| Molecular Weight | 312.800 g/mol |
|---|---|
| XLogP3 | 5.900 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 10 |
| Exact Mass | 312.149 Da |
| Monoisotopic Mass | 312.149 Da |
| Topological Polar Surface Area | 35.500 Ų |
| Heavy Atom Count | 21 |
| Formal Charge | 0 |
| Complexity | 294.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |