Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
L116310-500g
|
500g |
Available within 4-8 weeks(?)
Items will be manufactured post-order and can take 4-8 weeks. Thank you for your patience!
|
$42.90
|
|
| Synonyms | Stearyl palmitate, >=99% | Unat | Lanolin anhydrous | BAY-g 5421 | 3,5-Heptanedione, 4-(6-(2-chloro-4-methoxyphenoxy)hexyl)- | EINECS 309-376-3 | AI3-30713 | AKOS028115046 | Q27157447 | EINECS 220-000-6 | Octadecyl hexadecanoate | PALMITIC ACID, STEARYL E |
|---|---|
| Specifications & Purity | CP |
| Biochemical and Physiological Mechanisms | Lanolin is a complex waxy substance composed of varying quantities of long-chain waxy esters and lanolin alcohols, acids and polycarbons. Lanolin is used in a wide variety of creams, ointments and emollients. Lanolin is often studied to determine it aller |
| Shipped In | Normal |
| Grade | CP |
| Product Description |
Product Application: |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Lipids and lipid-like molecules |
| Class | Fatty Acyls |
| Subclass | Fatty acid esters |
| Intermediate Tree Nodes | Wax esters |
| Direct Parent | Wax monoesters |
| Alternative Parents | Fatty alcohol esters Carboxylic acid esters Monocarboxylic acids and derivatives Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Wax monoester skeleton - Fatty alcohol ester - Carboxylic acid ester - Monocarboxylic acid or derivatives - Carboxylic acid derivative - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Carbonyl group - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as wax monoesters. These are waxes bearing an ester group at exactly one position. |
| External Descriptors | Wax monoesters |
|
|
|
| IUPAC Name | octadecyl hexadecanoate |
|---|---|
| INCHI | InChI=1S/C34H68O2/c1-3-5-7-9-11-13-15-17-18-19-21-23-25-27-29-31-33-36-34(35)32-30-28-26-24-22-20-16-14-12-10-8-6-4-2/h3-33H2,1-2H3 |
| InChIKey | BILPUZXRUDPOOF-UHFFFAOYSA-N |
| Smiles | CCCCCCCCCCCCCCCCCCOC(=O)CCCCCCCCCCCCCCC |
| Isomeric SMILES | CCCCCCCCCCCCCCCCCCOC(=O)CCCCCCCCCCCCCCC |
| WGK Germany | 1 |
| RTECS | OE3201000 |
| Reaxy-Rn | 1806384 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1806384&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Jun 09, 2025 | L116310 | |
| Certificate of Analysis | Jun 09, 2025 | L116310 | |
| Certificate of Analysis | Jun 09, 2025 | L116310 |
| Flash Point(°F) | >110℃ |
|---|---|
| Flash Point(°C) | >110℃ |
| Melt Point(°C) | 38-42°C |
| Molecular Weight | 508.900 g/mol |
| XLogP3 | 16.300 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 32 |
| Exact Mass | 508.522 Da |
| Monoisotopic Mass | 508.522 Da |
| Topological Polar Surface Area | 26.300 Ų |
| Heavy Atom Count | 36 |
| Formal Charge | 0 |
| Complexity | 406.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Xun He, Jingsong Liu, Yugang Gong, Wei Lu, Xiaowei Sha, Chang Cao, Yanqun Li, Jiawei Wang. (2024) Amygdalin ameliorates alopecia areata on C3H/HeJ mice by inhibiting inflammation through JAK2/STAT3 pathway. JOURNAL OF ETHNOPHARMACOLOGY, 331 (118317). |
| 2. Liu Yu-Xiao, Han Wen-Hao, Wang Jun-Xia, Zhang Feng-Bin, Ji Shun-Xia, Zhong Yu-Wei, Liu Shu-Sheng, Wang Xiao-Wei. (2024) Differential induction of JA/SA determines plant defense against successive leaf-chewing and phloem-feeding insects. JOURNAL OF PEST SCIENCE, (1-16). |
| 3. Kaiming Mao, Chengzhe Li, Huacai Zhai, Yuying Wang, Yonggen Lou, Wenhua Xue, Guoxin Zhou. (2024) OsRCI-1-Mediated GLVs Enhance Rice Resistance to Brown Planthoppers. Plants-Basel, 13 (11): (1494). |
| 4. Lingsu Zhang, Liwei Qi, Weifu Dong, Tatsuo Kaneko, Hongji Zhang, Mingqing Chen, Dongjian Shi. (2025) Structural regulation and enhanced sunscreen performances of functional shellac nanoparticles. COLLOIDS AND SURFACES A-PHYSICOCHEMICAL AND ENGINEERING ASPECTS, 711 (136305). |
| 5. He Wu, Wen-Hao Han, Kai-Lu Liang, Jun-Xia Wang, Feng-Bin Zhang, Shun-Xia Ji, Shu-Sheng Liu, Xiao-Wei Wang. (2024) Using salicylic acid-responsive promoters to drive the expression of jasmonic acid-regulated genes enhances plant resistance to whiteflies. PEST MANAGEMENT SCIENCE, |