Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
L117742-25mg
|
25mg |
3
|
$117.90
|
|
|
L117742-100mg
|
100mg |
2
|
$315.90
|
|
| Synonyms | L-Leucine (15N, 98%) | H-[15N]LEU-OH | HY-N0486S3 | DTXSID60438103 | (2S)-2-(15N)Azanyl-4-methylpentanoic acid | L-Leucine-15N, 98 atom % 15N, S & P tested | MFCD00075212 | L-Leucine-15N, 98 atom % 15N | MS-22783 | L-Leucine-15N |
|---|---|
| Specifications & Purity | ≥98 atom%,≥98% |
| Storage Temp | Argon charged |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Carboxylic acids and derivatives |
| Subclass | Amino acids, peptides, and analogues |
| Intermediate Tree Nodes | Amino acids and derivatives - Alpha amino acids and derivatives |
| Direct Parent | Leucine and derivatives |
| Alternative Parents | L-alpha-amino acids Methyl-branched fatty acids Amino acids Monocarboxylic acids and derivatives Carboxylic acids Organic oxides Monoalkylamines Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Leucine or derivatives - Alpha-amino acid - L-alpha-amino acid - Branched fatty acid - Methyl-branched fatty acid - Fatty acyl - Fatty acid - Amino acid - Carboxylic acid - Monocarboxylic acid or derivatives - Organic nitrogen compound - Primary amine - Organooxygen compound - Organonitrogen compound - Hydrocarbon derivative - Primary aliphatic amine - Organic oxide - Carbonyl group - Organic oxygen compound - Amine - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as leucine and derivatives. These are compounds containing leucine or a derivative thereof resulting from reaction of leucine at the amino group or the carboxy group, or from the replacement of any hydrogen of glycine by a heteroatom. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 488196631 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488196631 |
| IUPAC Name | (2S)-2-(15N)azanyl-4-methylpentanoic acid |
| INCHI | InChI=1S/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t5-/m0/s1/i7+1 |
| InChIKey | ROHFNLRQFUQHCH-GEERXGHESA-N |
| Smiles | CC(C)CC(C(=O)O)N |
| Isomeric SMILES | CC(C)C[C@@H](C(=O)O)[15NH2] |
| WGK Germany | 1 |
| Molecular Weight | 132.17 |
| Reaxy-Rn | 636005 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=636005&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Jun 09, 2023 | L117742 | |
| Certificate of Analysis | Jun 09, 2023 | L117742 | |
| Certificate of Analysis | Jun 09, 2023 | L117742 | |
| Certificate of Analysis | Jun 09, 2023 | L117742 |
| Sensitivity | Hygroscopic |
|---|---|
| Molecular Weight | 132.170 g/mol |
| XLogP3 | -1.500 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 3 |
| Exact Mass | 132.092 Da |
| Monoisotopic Mass | 132.092 Da |
| Topological Polar Surface Area | 63.300 Ų |
| Heavy Atom Count | 9 |
| Formal Charge | 0 |
| Complexity | 101.000 |
| Isotope Atom Count | 1 |
| Defined Atom Stereocenter Count | 1 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |