Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
G477949-25ml
|
25ml |
1
|
$45.90
|
|
| Synonyms | CHEBI:131424 | Acetic acid, (2-ethoxyethoxy)- | LVLQKFRSMSHJIE-UHFFFAOYSA-N | Z316258972 | SCHEMBL1172675 | 2-(2-ethoxyethoxy)acetic acid | DTXSID20228143 | 2-(2-ethoxyethoxy)aceticacid | (2-Ethoxyethoxy)acetic acid | AKOS000172598 | beta-ethoxyethoxyacet |
|---|---|
| Specifications & Purity | average Mₙ ~360 |
| Storage Temp | Room temperature |
| Shipped In | Normal |
| Product Description |
Description Surfactant.Stabilizer for microemulsions. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Carboxylic acids and derivatives |
| Subclass | Carboxylic acids |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Carboxylic acids |
| Alternative Parents | Monocarboxylic acids and derivatives Dialkyl ethers Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Monocarboxylic acid or derivatives - Ether - Dialkyl ether - Carboxylic acid - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Carbonyl group - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as carboxylic acids. These are compounds containing a carboxylic acid group with the formula -C(=O)OH. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2-(2-ethoxyethoxy)acetic acid |
|---|---|
| INCHI | InChI=1S/C6H12O4/c1-2-9-3-4-10-5-6(7)8/h2-5H2,1H3,(H,7,8) |
| InChIKey | LVLQKFRSMSHJIE-UHFFFAOYSA-N |
| Smiles | CCOCCOCC(=O)O |
| Isomeric SMILES | CCOCCOCC(=O)O |
| Molecular Weight | 148.16 |
| Reaxy-Rn | 1756616 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1756616&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Feb 17, 2025 | G477949 | |
| Certificate of Analysis | Sep 27, 2024 | G477949 | |
| Certificate of Analysis | Sep 27, 2024 | G477949 |
| Refractive Index | n20/D 1.45 |
|---|---|
| Molecular Weight | 148.160 g/mol |
| XLogP3 | -0.100 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 6 |
| Exact Mass | 148.074 Da |
| Monoisotopic Mass | 148.074 Da |
| Topological Polar Surface Area | 55.800 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 91.700 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |