Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
G477469-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$159.90
|
|
|
G477469-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$622.90
|
|
| Synonyms | [1,4]-dioxan-2,5-diol | EINECS 204-590-2 | DTXSID60945822 | JNG39F464R | Glycoaldehyde dimer | 1,4-Dioxane-2,5-diol # | 14-Dioxane-25-diol | D92592 | SCHEMBL52731 | 2,5-DIHYDROXY-P-DIOXANE | FT-0602682 | s3334 | 1,4-Dioxane-2,5-diol | AM20090246 | EN300-8 |
|---|---|
| Specifications & Purity | crystalline,mixture of stereoisomers. Melts between 80 and 90°C depending on stereoisomeric composition |
| Storage Temp | Store at 2-8°C |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
| Product Description |
Description Glycolaldehyde dimer may be used in the synthesis of 3,4-diaza-2-hexene-1,6-diol, which can undergo hydrogenation to form 1,2-bis(2-hydroxyethyl)hydrazine. It undergoes cycloaddition with 2,3-dihydrofuran in the presence of a chiral catalyst to form fused bicyclic tetrahydrofuran (bis-THF) alcohol, a key moiety of HIV protease inhibitors. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Dioxanes |
| Subclass | 1,4-dioxanes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | 1,4-dioxanes |
| Alternative Parents | Hemiacetals Oxacyclic compounds Hydrocarbon derivatives |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Para-dioxane - Hemiacetal - Oxacycle - Organic oxygen compound - Hydrocarbon derivative - Organooxygen compound - Aliphatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as 1,4-dioxanes. These are organic compounds containing 1,4-dioxane, an aliphatic six-member ring with two oxygen atoms in ring positions 1 and 4. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 1,4-dioxane-2,5-diol |
|---|---|
| INCHI | InChI=1S/C4H8O4/c5-3-1-7-4(6)2-8-3/h3-6H,1-2H2 |
| InChIKey | ATFVTAOSZBVGHC-UHFFFAOYSA-N |
| Smiles | C1C(OCC(O1)O)O |
| Isomeric SMILES | C1C(OCC(O1)O)O |
| WGK Germany | 3 |
| Molecular Weight | 120.1 |
| Beilstein | 506029 |
| Reaxy-Rn | 104399 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=104399&ln= |
| Molecular Weight | 120.100 g/mol |
|---|---|
| XLogP3 | -1.300 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 0 |
| Exact Mass | 120.042 Da |
| Monoisotopic Mass | 120.042 Da |
| Topological Polar Surface Area | 58.900 Ų |
| Heavy Atom Count | 8 |
| Formal Charge | 0 |
| Complexity | 64.400 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 2 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Qiying Liu, Haiyong Wang, Haosheng Xin, Chenguang Wang, Long Yan, Yingxiong Wang, Qi Zhang, Xinghua Zhang, Ying Xu, George W. Huber, Longlong Ma. (2019) Selective Cellulose Hydrogenolysis to Ethanol Using Ni@C Combined with Phosphoric Acid Catalysts. ChemSusChem, 12 (17): (3977-3987). |
| 2. Muge Niu, Yucui Hou, Weize Wu, Shuhang Ren, Ru Yang. (2018) Successive C1–C2 bond cleavage: the mechanism of vanadium(V)-catalyzed aerobic oxidation of D-glucose to formic acid in aqueous solution. PHYSICAL CHEMISTRY CHEMICAL PHYSICS, 20 (26): (17942-17951). |
| 3. Likun Luan, Yingfang Zhang, Xiuling Ji, Boxia Guo, Shaoyu Song, Yuhong Huang, Suojiang Zhang. (2024) Electro-Driven Multi-Enzymatic Cascade Conversion of CO2 to Ethylene Glycol in Nano-Reactor. Advanced Science, (2407204). |