Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
E183942-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$63.90
|
|
Discover Ethyl 6-iodo-4-oxo-4h-chromene-2-carboxylate by Aladdin Scientific in 95% for only $63.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | Ethyl 6-iodo-4-oxo-4H-chromene-2-carboxylate | 35204-44-5 | ethyl 6-iodo-4-oxochromene-2-carboxylate | Maybridge1_002002 | SCHEMBL2811962 | HMS547C22 | DTXSID80379468 | HUJFMOAXSPSGDU-UHFFFAOYSA-N | Ethyl 6-iodochromone-2-carboxylate | MFCD00100378 | AKOS025393440 | CCG-235201 |
|---|---|
| Specifications & Purity | ≥95% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Benzopyrans |
| Subclass | 1-benzopyrans |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Chromones |
| Alternative Parents | Pyranones and derivatives Benzenoids Aryl iodides Heteroaromatic compounds Carboxylic acid esters Oxacyclic compounds Monocarboxylic acids and derivatives Organooxygen compounds Organoiodides Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Chromone - Pyranone - Aryl halide - Aryl iodide - Benzenoid - Pyran - Heteroaromatic compound - Carboxylic acid ester - Carboxylic acid derivative - Oxacycle - Monocarboxylic acid or derivatives - Organic oxide - Organic oxygen compound - Hydrocarbon derivative - Organohalogen compound - Organoiodide - Organooxygen compound - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as chromones. These are compounds containing a benzopyran-4-one moiety. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | ethyl 6-iodo-4-oxochromene-2-carboxylate |
|---|---|
| INCHI | InChI=1S/C12H9IO4/c1-2-16-12(15)11-6-9(14)8-5-7(13)3-4-10(8)17-11/h3-6H,2H2,1H3 |
| InChIKey | HUJFMOAXSPSGDU-UHFFFAOYSA-N |
| Smiles | CCOC(=O)C1=CC(=O)C2=C(O1)C=CC(=C2)I |
| Isomeric SMILES | CCOC(=O)C1=CC(=O)C2=C(O1)C=CC(=C2)I |
| Molecular Weight | 344.1 |
| Reaxy-Rn | 22773329 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=22773329&ln= |
| Molecular Weight | 344.100 g/mol |
|---|---|
| XLogP3 | 3.000 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 3 |
| Exact Mass | 343.955 Da |
| Monoisotopic Mass | 343.955 Da |
| Topological Polar Surface Area | 52.600 Ų |
| Heavy Atom Count | 17 |
| Formal Charge | 0 |
| Complexity | 364.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |