Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
E637509-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$639.90
|
|
| Synonyms | 1251013-42-9 | Ethyl 6-bromoimidazo[1,2-a]pyrimidine-3-carboxylate | 6-Bromo-Imidazo[1,2-A]Pyrimidine-3-Carboxylic Acid Ethyl Ester | Ethyl6-bromoimidazo[1,2-a]pyrimidine-3-carboxylate | SCHEMBL19736932 | BAC01342 | MFCD14581542 | AM805307 | AS-68476 | F5 |
|---|---|
| Specifications & Purity | ≥97% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Imidazo[1,2-a]pyrimidines |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Imidazo[1,2-a]pyrimidines |
| Alternative Parents | Halopyrimidines Carbonylimidazoles N-substituted imidazoles Aryl bromides Heteroaromatic compounds Carboxylic acid esters Azacyclic compounds Organooxygen compounds Organonitrogen compounds Organobromides Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Imidazo[1,2-a]pyrimidine - Imidazole-4-carbonyl group - Halopyrimidine - Aryl bromide - Aryl halide - Pyrimidine - N-substituted imidazole - Azole - Heteroaromatic compound - Imidazole - Carboxylic acid ester - Carboxylic acid derivative - Azacycle - Organonitrogen compound - Organooxygen compound - Organic nitrogen compound - Hydrocarbon derivative - Organic oxide - Organic oxygen compound - Organobromide - Organohalogen compound - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as imidazo[1,2-a]pyrimidines. These are aromatic heteropolycyclic compounds containing an imidazole ring fused to and sharing one nitrogen with a pyrimidine ring. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | ethyl 6-bromoimidazo[1,2-a]pyrimidine-3-carboxylate |
|---|---|
| INCHI | InChI=1S/C9H8BrN3O2/c1-2-15-8(14)7-4-12-9-11-3-6(10)5-13(7)9/h3-5H,2H2,1H3 |
| InChIKey | WDILKVDGYVAARP-UHFFFAOYSA-N |
| Smiles | CCOC(=O)C1=CN=C2N1C=C(C=N2)Br |
| Isomeric SMILES | CCOC(=O)C1=CN=C2N1C=C(C=N2)Br |
| PubChem CID | 71305759 |
| Molecular Weight | 270.08 |
| Molecular Weight | 270.080 g/mol |
|---|---|
| XLogP3 | 2.400 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 3 |
| Exact Mass | 268.98 Da |
| Monoisotopic Mass | 268.98 Da |
| Topological Polar Surface Area | 56.500 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 252.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |