Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
E173992-250mg
|
250mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$123.90
|
|
Discover ethyl 2-(3-hydroxycyclobutyl)acetate by Aladdin Scientific in 97% for only $123.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | ethyl 2-(3-hydroxycyclobutyl)acetate | 1408075-22-8 | Ethyl cis-(3-Hydroxycyclobutyl)acetate | 1408075-71-7 | 1408075-85-3 | Ethyl trans-(3-Hydroxycyclobutyl)acetate | Ethyl (3-Hydroxycyclobutyl)acetate | Ethyl 2-(cis-3-hydroxycyclobutyl)acetate | Ethyl 2-(trans-3-hydrox |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Class | Organooxygen compounds |
| Subclass | Alcohols and polyols |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Cyclic alcohols and derivatives |
| Alternative Parents | Secondary alcohols Carboxylic acid esters Monocarboxylic acids and derivatives Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic homomonocyclic compounds |
| Substituents | Secondary alcohol - Cyclobutanol - Carboxylic acid ester - Monocarboxylic acid or derivatives - Carboxylic acid derivative - Organic oxide - Hydrocarbon derivative - Carbonyl group - Aliphatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as cyclic alcohols and derivatives. These are organic compounds containing an aliphatic ring substituted with at least one hydroxyl group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | ethyl 2-(3-hydroxycyclobutyl)acetate |
|---|---|
| INCHI | InChI=1S/C8H14O3/c1-2-11-8(10)5-6-3-7(9)4-6/h6-7,9H,2-5H2,1H3 |
| InChIKey | AVEZUPSKZQQURH-UHFFFAOYSA-N |
| Smiles | CCOC(=O)CC1CC(C1)O |
| Isomeric SMILES | CCOC(=O)CC1CC(C1)O |
| Molecular Weight | 158.197 |
| Reaxy-Rn | 23220927 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=23220927&ln= |
| Molecular Weight | 158.190 g/mol |
|---|---|
| XLogP3 | 0.500 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 4 |
| Exact Mass | 158.094 Da |
| Monoisotopic Mass | 158.094 Da |
| Topological Polar Surface Area | 46.500 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 138.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |