Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
Basic Description
| Synonyms | 3-amino-2-methylpropanoic acid | dl-3-Aminoisobutyric acid | 144-90-1 | 3-Aminoisobutyric acid | 10569-72-9 | Propanoic acid, 3-amino-2-methyl- | dl-beta-Aminoisobutyric acid | beta-Aminoisobutyric acid | 3-Aminoisobutanoate | alpha-Methyl-beta-alanine | dl-3-Amino-2-methylp |
|---|---|
| Specifications & Purity | 10mM in Water |
| Storage Temp | Store at -80°C |
| Shipped In |
Ice chest + Ice pads This product requires cold chain shipping. Ground and other economy services are not available. |
| Product Description |
A beta-amino acid used for proteomics research. |
Taxonomic Classification
Taxonomy Tree
-
Kingdom
Organic compounds
- Superclass Organic acids and derivatives
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Carboxylic acids and derivatives |
| Subclass | Amino acids, peptides, and analogues |
| Intermediate Tree Nodes | Amino acids and derivatives |
| Direct Parent | Beta amino acids and derivatives |
| Alternative Parents | Amino acids Monocarboxylic acids and derivatives Carboxylic acids Organopnictogen compounds Organic oxides Monoalkylamines Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Beta amino acid or derivatives - Amino acid - Carboxylic acid - Monocarboxylic acid or derivatives - Amine - Organic oxide - Hydrocarbon derivative - Primary amine - Organooxygen compound - Organonitrogen compound - Organopnictogen compound - Primary aliphatic amine - Organic oxygen compound - Carbonyl group - Organic nitrogen compound - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as beta amino acids and derivatives. These are amino acids having a (-NH2) group attached to the beta carbon atom. |
| External Descriptors | Amino fatty acids |
|
|
|
Names and Identifiers
| IUPAC Name | 3-amino-2-methylpropanoic acid |
|---|---|
| INCHI | InChI=1S/C4H9NO2/c1-3(2-5)4(6)7/h3H,2,5H2,1H3,(H,6,7) |
| InChIKey | QCHPKSFMDHPSNR-UHFFFAOYSA-N |
| Smiles | CC(CN)C(=O)O |
| Isomeric SMILES | CC(CN)C(=O)O |
| WGK Germany | 3 |
| RTECS | UA2430000 |
| Alternate CAS | 10569-72-9 |
| Molecular Weight | 103.12 |
| Beilstein | 1720958 |
| Reaxy-Rn | 1720958 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1720958&ln= |
Certificates（CoA,COO,BSE/TSE and Analysis Chart)
C of A & Other Certificates(BSE/TSE, COO):
Analytical Chart:
Chemical and Physical Properties
| Melt Point(°C) | 179-182°C |
|---|---|
| Molecular Weight | 103.120 g/mol |
| XLogP3 | -2.900 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 2 |
| Exact Mass | 103.063 Da |
| Monoisotopic Mass | 103.063 Da |
| Topological Polar Surface Area | 63.300 Ų |
| Heavy Atom Count | 7 |
| Formal Charge | 0 |
| Complexity | 72.100 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
Solution Calculators
Reviews
Customer Reviews
Remind me later