Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D114922-100mg
|
100mg |
2
|
$255.90
|
|
| Synonyms | 1,3,5-Triazine-2,4-diamine, N,N'-bis(1-methylethyl)-6-(ethylthio)- | Dipropetryne [ISO-French] | GS 16068 | 6-(Ethylthio)-N,N'-bis(1-methylethyl)-1,3,5-triazine-2,4-diamine | 6-(ethylthio)-N2,N4-diisopropyl-1,3,5-triazine-2,4-diamine | s-Triazine, 2-(ethy |
|---|---|
| Specifications & Purity | analytical standard |
| Shipped In | Normal |
| Grade | analytical standard |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Triazines |
| Subclass | 1,3,5-triazines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Alkyl-2-thio-S-triazines |
| Alternative Parents | Alkylarylthioethers Heteroaromatic compounds Sulfenyl compounds Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Alkyl-2-thio-s-triazine - Aryl thioether - Alkylarylthioether - Heteroaromatic compound - Azacycle - Sulfenyl compound - Thioether - Organic nitrogen compound - Organopnictogen compound - Hydrocarbon derivative - Organosulfur compound - Organonitrogen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as alkyl-2-thio-s-triazines. These are aromatic compounds containing a 1,3,5-triazine ring that is substituted at the 2-position with a S-alkyl group. |
| External Descriptors | Triazine herbicides |
|
|
|
| IUPAC Name | 6-ethylsulfanyl-2-N,4-N-di(propan-2-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| INCHI | InChI=1S/C11H21N5S/c1-6-17-11-15-9(12-7(2)3)14-10(16-11)13-8(4)5/h7-8H,6H2,1-5H3,(H2,12,13,14,15,16) |
| InChIKey | NPWMZOGDXOFZIN-UHFFFAOYSA-N |
| Smiles | CCSC1=NC(=NC(=N1)NC(C)C)NC(C)C |
| Isomeric SMILES | CCSC1=NC(=NC(=N1)NC(C)C)NC(C)C |
| WGK Germany | 2 |
| RTECS | XY4100000 |
| UN Number | 3077 |
| Molecular Weight | 255.38 |
| Beilstein | 614796 |
| Reaxy-Rn | 614796 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=614796&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Mar 01, 2023 | D114922 | |
| Certificate of Analysis | May 12, 2022 | D114922 | |
| Certificate of Analysis | May 12, 2022 | D114922 |
| Molecular Weight | 255.390 g/mol |
|---|---|
| XLogP3 | 3.900 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 6 |
| Exact Mass | 255.152 Da |
| Monoisotopic Mass | 255.152 Da |
| Topological Polar Surface Area | 88.000 Ų |
| Heavy Atom Count | 17 |
| Formal Charge | 0 |
| Complexity | 194.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |