Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D424600-1ml
|
1ml |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$103.90
|
|
| Synonyms | Diphenylamine hydrochloride | 537-67-7 | N-phenylaniline hydrochloride | Diphenylammonium chloride | Benzenamine, N-phenyl-, hydrochloride | Diphenylamine (hydrochloride) | DIPHENYLAMINE HCL | Diphenylamine, hydrochloride | N-phenylaniline;hydrochloride | DD564FD4QR | N-Phen |
|---|---|
| Specifications & Purity | 10mM in DMSO |
| Storage Temp | Store at -80°C |
| Shipped In |
Ice chest + Ice pads This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Aniline and substituted anilines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Aniline and substituted anilines |
| Alternative Parents | Secondary amines Organopnictogen compounds Hydrochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Aniline or substituted anilines - Secondary amine - Organic nitrogen compound - Organopnictogen compound - Hydrocarbon derivative - Hydrochloride - Organonitrogen compound - Amine - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as aniline and substituted anilines. These are organic compounds containing an aminobenzene moiety. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | N-phenylaniline;hydrochloride |
|---|---|
| INCHI | InChI=1S/C12H11N.ClH/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;/h1-10,13H;1H |
| InChIKey | JEFJSEIUEJBMSR-UHFFFAOYSA-N |
| Smiles | C1=CC=C(C=C1)NC2=CC=CC=C2.Cl |
| Isomeric SMILES | C1=CC=C(C=C1)NC2=CC=CC=C2.Cl |
| Molecular Weight | 205.69 |
| Reaxy-Rn | 3693106 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=3693106&ln= |
| Sensitivity | Air &Light &Heat sensitive |
|---|---|
| Melt Point(°C) | 180 °C(dec.) |
| Molecular Weight | 205.680 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 2 |
| Exact Mass | 205.066 Da |
| Monoisotopic Mass | 205.066 Da |
| Topological Polar Surface Area | 12.000 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 116.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |