Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D404203-1g
|
1g |
3
|
$269.90
|
|
|
D404203-5g
|
5g |
1
|
$349.90
|
|
| Synonyms | D5238 | T70061 | N,N-Diethyl-N-methyl-N-(2-methoxyethyl)ammonium imidodisulfuryl fluoride | 1079129-48-8 | N,N-Diethyl-N-methyl-N-(2-methoxyethyl)ammoniumimidodisulfurylfluoride | N,N-Diethyl-2-methoxy-N-methylethanaminium Bis(fluorosulfonyl)amide | Dieth |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Argon charged |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic nitrogen compounds |
| Class | Organonitrogen compounds |
| Subclass | Quaternary ammonium salts |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Cholines |
| Alternative Parents | Tetraalkylammonium salts Dialkyl ethers Organic salts Organic oxides Hydrocarbon derivatives Amines Organic cations |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Choline - Tetraalkylammonium salt - Ether - Dialkyl ether - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organic salt - Organooxygen compound - Amine - Organic cation - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as cholines. These are organic compounds containing a N,N,N-trimethylethanolammonium cation. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 504772352 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504772352 |
| IUPAC Name | bis(fluorosulfonyl)azanide;diethyl-(2-methoxyethyl)-methylazanium |
| INCHI | InChI=1S/C8H20NO.F2NO4S2/c1-5-9(3,6-2)7-8-10-4;1-8(4,5)3-9(2,6)7/h5-8H2,1-4H3;/q+1;-1 |
| InChIKey | OHKPLVVWXQGNTL-UHFFFAOYSA-N |
| Smiles | CC[N+](C)(CC)CCOC.[N-](S(=O)(=O)F)S(=O)(=O)F |
| Isomeric SMILES | CC[N+](C)(CC)CCOC.[N-](S(=O)(=O)F)S(=O)(=O)F |
| Molecular Weight | 326.37 |
| Reaxy-Rn | 19655124 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=19655124&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Mar 04, 2024 | D404203 | |
| Certificate of Analysis | Mar 04, 2024 | D404203 | |
| Certificate of Analysis | Mar 04, 2024 | D404203 | |
| Certificate of Analysis | Mar 04, 2024 | D404203 |
| Sensitivity | Hygroscopic |
|---|---|
| Refractive Index | 1.44 |
| Melt Point(°C) | -22 °C |
| Molecular Weight | 326.400 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 8 |
| Rotatable Bond Count | 7 |
| Exact Mass | 326.078 Da |
| Monoisotopic Mass | 326.078 Da |
| Topological Polar Surface Area | 95.300 Ų |
| Heavy Atom Count | 19 |
| Formal Charge | 0 |
| Complexity | 310.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |
| 1. Jianpeng Zhang, Yuhang Li, Yufeng Xing. (2019) Ultrasoft, Adhesive and Millimeter Scale Epidermis Electronic Sensor for Real-Time Enduringly Monitoring Skin Strain. SENSORS, 19 (11): (2442). |