Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C579315-500g
|
500g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$250.90
|
|
| Synonyms | COBALTOUS SULFAMATE | 14017-41-5 | Cobalt (II) Sulfamate | COBALT SULFAMATE | cobalt(2+);disulfamate | Cobalt(2+) disulphamate | 0UHD1PCY6U | cobalt(2+) disulfamate | UNII-0UHD1PCY6U | HSDB 1986 | EINECS 237-834-1 | DTXSID50890736 | WLQXLCXXAPYDIU-UHFFFAOYSA-L | COBALTOUS SULFAMAT |
|---|---|
| Specifications & Purity | ≥85% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Inorganic compounds |
|---|---|
| Superclass | Mixed metal/non-metal compounds |
| Class | Transition metal organides |
| Subclass | Transition metal oxides |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Transition metal oxides |
| Alternative Parents | Sulfuric acid monoamides Inorganic oxides Inorganic cobalt salts |
| Molecular Framework | Not available |
| Substituents | Transition metal oxide - Sulfuric acid monoamide - Inorganic cobalt salt - Inorganic oxide - Inorganic salt |
| Description | This compound belongs to the class of inorganic compounds known as transition metal oxides. These are inorganic compounds containing an oxygen atom of an oxidation state of -2, in which the heaviest atom bonded to the oxygen is a transition metal. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | cobalt(2+);disulfamate |
|---|---|
| INCHI | InChI=1S/Co.2H3NO3S/c;2*1-5(2,3)4/h;2*(H3,1,2,3,4)/q+2;;/p-2 |
| InChIKey | WLQXLCXXAPYDIU-UHFFFAOYSA-L |
| Smiles | NS(=O)(=O)[O-].NS(=O)(=O)[O-].[Co+2] |
| Isomeric SMILES | NS(=O)(=O)[O-].NS(=O)(=O)[O-].[Co+2] |
| Molecular Weight | 251.11(as Anhydrous) |
| Reaxy-Rn | 16498613 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=16498613&ln= |
| Solubility | Soluble in water. |
|---|---|
| Sensitivity | Sensitive to humidity and heat;Hygroscopic |
| Molecular Weight | 251.110 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 8 |
| Rotatable Bond Count | 0 |
| Exact Mass | 250.884 Da |
| Monoisotopic Mass | 250.884 Da |
| Topological Polar Surface Area | 183.000 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 79.200 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 3 |
Starting at $49.90