Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C470366-250mg
|
250mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$184.90
|
|
| Synonyms | cis-Dichlorobis(pyridine)platinum(II), 97% | dichloroplatinum; pyridine | CIS-BIS(PYRIDINE)PLATINUM(II) CHLORIDE;CIS-DICHLOROBIS(PYRIDINE)PLATINUM(II);DICHLOROBIS(PYRIDINE) PLATINUM (II);PLATINUM CIS-DICHLOROBISPYRIDINE | cis-Dichlorobis(pyridine)platinum |
|---|---|
| Specifications & Purity | ≥97% |
| Product Description |
Description Reactant for synthesis of platinum catalysts |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyridines and derivatives |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Pyridines and derivatives |
| Alternative Parents | Heteroaromatic compounds Organic transition metal salts Organic metal halides Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Organic chloride salts Hydrocarbon derivatives |
| Molecular Framework | Not available |
| Substituents | Pyridine - Heteroaromatic compound - Organic metal halide - Azacycle - Organic transition metal salt - Organic nitrogen compound - Organopnictogen compound - Hydrocarbon derivative - Organic chloride salt - Organic salt - Organonitrogen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as pyridines and derivatives. These are compounds containing a pyridine ring, which is a six-member aromatic heterocycle which consists of one nitrogen atom and five carbon atoms. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | dichloroplatinum;pyridine |
|---|---|
| INCHI | InChI=1S/2C5H5N.2ClH.Pt/c2*1-2-4-6-5-3-1;;;/h2*1-5H;2*1H;/q;;;;+2/p-2 |
| InChIKey | FCJXCLMZOWAKNQ-UHFFFAOYSA-L |
| Smiles | C1=CC=NC=C1.C1=CC=NC=C1.Cl[Pt]Cl |
| Isomeric SMILES | C1=CC=NC=C1.C1=CC=NC=C1.Cl[Pt]Cl |
| PubChem CID | 498600 |
| Molecular Weight | 424.2 |
| Molecular Weight | 424.200 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 0 |
| Exact Mass | 422.987 Da |
| Monoisotopic Mass | 422.987 Da |
| Topological Polar Surface Area | 25.800 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 33.700 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 3 |